Difference between revisions of "5-HYDROXYINDOLE ACETATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R222-RXN R222-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-octanal dehydrogenase (NAD+...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] == * smiles: ** C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R222-RXN R222-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))
 +
* inchi key:
 +
** InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** 1-octanal dehydrogenase (NAD+)
+
** 5-hydroxyindole acetate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3]
+
** 190.178   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-hydroxyindoleacetic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[NAD]][c] '''+''' 1 [[CPD-371]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-195]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[NADH]][c]
+
* [[RXN-10780]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NAD+[c] '''+''' 1 1-octanal[c] '''+''' 1 H2O[c] '''=>''' 1 octanoate[c] '''+''' 2 H+[c] '''+''' 1 NADH[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[P221-PWY]], octane oxidation: [http://metacyc.org/META/NEW-IMAGE?object=P221-PWY P221-PWY]
+
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 54-16-0
−
{{#set: common name=1-octanal dehydrogenase (NAD+)}}
+
* PUBCHEM:
−
{{#set: ec number=EC-1.2.1.3}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3772821 3772821]
−
{{#set: in pathway=P221-PWY}}
+
* HMDB : HMDB00763
−
{{#set: reconstruction category=annotation}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05635 C05635]
−
{{#set: reconstruction source=esiliculosus_genome}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.3001356.html 3001356]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62622 62622]
 +
{{#set: smiles=C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))}}
 +
{{#set: inchi key=InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M}}
 +
{{#set: common name=5-hydroxyindole acetate}}
 +
{{#set: molecular weight=190.178    }}
 +
{{#set: common name=5-hydroxyindoleacetic acid}}
 +
{{#set: produced by=RXN-10780}}

Latest revision as of 20:12, 21 March 2018

Metabolite 5-HYDROXYINDOLE_ACETATE

  • smiles:
    • C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))
  • inchi key:
    • InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M
  • common name:
    • 5-hydroxyindole acetate
  • molecular weight:
    • 190.178
  • Synonym(s):
    • 5-hydroxyindoleacetic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=5-HYDROXYINDOLE_ACETATE&oldid=25260"