Difference between revisions of "ARGDEG-III-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10911 RXN-10911] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10911 RXN-10911] ==
−
* smiles:
+
* direction:
−
** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
+
** [http://enzyme.expasy.org/EC/1.1.1.1 EC-1.1.1.1]
−
* common name:
+
−
** 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
+
−
* molecular weight:
+
−
** 442.724   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 3,4-dihydroxyphenylglycol dehydrogenase
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN66-13]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[DIHYDROXYPHENYLGLYCOLALDEHYDE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[CPD-11878]][c] '''+''' 1 [[NAD]][c]
−
* [[RXN66-12]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 3,4-dihydroxyphenylglycolaldehyde[c] '''+''' 1 H+[c] '''+''' 1 NADH[c] '''=>''' 1 3,4-dihydroxyphenylglycol[c] '''+''' 1 NAD+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-16_001960]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-6342]], noradrenaline and adrenaline degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6342 PWY-6342]
 +
** '''1''' reactions found over '''13''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203343 25203343]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31147 31147]
−
* HMDB : HMDB12159
+
* LIGAND-RXN:
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R04880 R04880]
−
{{#set: inchi key=InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: common name=4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: ec number=EC-1.1.1.1}}
−
{{#set: molecular weight=442.724    }}
+
{{#set: common name=3,4-dihydroxyphenylglycol dehydrogenase}}
−
{{#set: consumed by=RXN66-13}}
+
{{#set: gene associated=Ec-16_001960}}
−
{{#set: produced by=RXN66-12}}
+
{{#set: in pathway=PWY-6342}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-aragem}}
 +
{{#set: reconstruction tool=pantograph}}

Revision as of 14:27, 21 March 2018

Reaction RXN-10911

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):
    • 3,4-dihydroxyphenylglycol dehydrogenase

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6342, noradrenaline and adrenaline degradation: PWY-6342
    • 1 reactions found over 13 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=ARGDEG-III-PWY&oldid=18799"