Difference between revisions of "C-DI-GMP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == * smiles: ** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1) * inchi key: ** InChIKey=LHFJO...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C-DI-GMP C-DI-GMP] == * smiles: ** C1(C7(C(OP([O-])(=O)OCC4(C(OP([O-])(=O)O1)C(O)C(N3(C2(N=C(N)...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C-DI-GMP C-DI-GMP] == |
* smiles: | * smiles: | ||
− | ** C(O) | + | ** C1(C7(C(OP([O-])(=O)OCC4(C(OP([O-])(=O)O1)C(O)C(N3(C2(N=C(N)NC(=O)C=2N=C3)))O4))C(O)C(N6(C5(N=C(N)NC(=O)C=5N=C6)))O7)) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PKFDLKSEZWEFGL-MHARETSRSA-L |
* common name: | * common name: | ||
− | ** | + | ** cyclic di-3',5'-guanylate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 688.4 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** cyclic di-3',5'-GMP |
− | ** | + | ** c-di-GMP |
− | ** | + | ** c-di-guanylate |
− | ** | + | ** cyclic bis(3' -> 5') dimeric GMP |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-5359]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245336 25245336] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58805 58805] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16463 C16463] |
− | {{#set: smiles=C(O) | + | {{#set: smiles=C1(C7(C(OP([O-])(=O)OCC4(C(OP([O-])(=O)O1)C(O)C(N3(C2(N=C(N)NC(=O)C=2N=C3)))O4))C(O)C(N6(C5(N=C(N)NC(=O)C=5N=C6)))O7))}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=PKFDLKSEZWEFGL-MHARETSRSA-L}} |
− | {{#set: common name= | + | {{#set: common name=cyclic di-3',5'-guanylate}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=688.4 }} |
− | {{#set: common name= | + | {{#set: common name=cyclic di-3',5'-GMP|c-di-GMP|c-di-guanylate|cyclic bis(3' -> 5') dimeric GMP}} |
− | + | {{#set: produced by=RXN0-5359}} | |
− | {{#set: produced by= | + |
Latest revision as of 20:42, 21 March 2018
Contents
Metabolite C-DI-GMP
- smiles:
- C1(C7(C(OP([O-])(=O)OCC4(C(OP([O-])(=O)O1)C(O)C(N3(C2(N=C(N)NC(=O)C=2N=C3)))O4))C(O)C(N6(C5(N=C(N)NC(=O)C=5N=C6)))O7))
- inchi key:
- InChIKey=PKFDLKSEZWEFGL-MHARETSRSA-L
- common name:
- cyclic di-3',5'-guanylate
- molecular weight:
- 688.4
- Synonym(s):
- cyclic di-3',5'-GMP
- c-di-GMP
- c-di-guanylate
- cyclic bis(3' -> 5') dimeric GMP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C7(C(OP([O-])(=O)OCC4(C(OP([O-])(=O)O1)C(O)C(N3(C2(N=C(N)NC(=O)C=2N=C3)))O4))C(O)C(N6(C5(N=C(N)NC(=O)C=5N=C6)))O7))" cannot be used as a page name in this wiki.
"cyclic bis(3' -> 5') dimeric GMP" cannot be used as a page name in this wiki.