Difference between revisions of "CPD-14704"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16418 RXN-16418] == * direction: ** LEFT-TO-RIGHT * common name: ** long chain acyl-coA synthet...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O |
| + | * inchi key: | ||
| + | ** InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-hydroxy-2-nonenal-glutathione conjugate |
| − | + | * molecular weight: | |
| − | * | + | ** 462.537 |
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-13673]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657725 90657725] | |
| − | {{#set: | + | {{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: common name=4-hydroxy-2-nonenal-glutathione conjugate}} |
| − | {{#set: | + | {{#set: molecular weight=462.537 }} |
| − | {{#set: | + | {{#set: produced by=RXN-13673}} |
| − | + | ||
| − | + | ||
Latest revision as of 20:37, 21 March 2018
Contents
Metabolite CPD-14704
- smiles:
- CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O
- inchi key:
- InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M
- common name:
- 4-hydroxy-2-nonenal-glutathione conjugate
- molecular weight:
- 462.537
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O" cannot be used as a page name in this wiki.
