Difference between revisions of "CPD-488"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12482 CPD-12482] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N(C)2)) * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] == * smiles: ** CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: ** InChIKe...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PTVXQARCLQPGIR-SXUWKVJYSA-L |
* common name: | * common name: | ||
− | ** | + | ** β-L-fucose 1-phosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 242.122 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-Fucose 1-phosphate |
+ | ** 6-deoxy-L-galactose 1-phosphate | ||
+ | ** L-fucopyranose 1-(dihydrogen phosphate) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[2.7.7.30-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[FUCOKINASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266535 45266535] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57268 57268] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02985 C02985] |
− | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB01265 |
− | {{#set: common name= | + | {{#set: smiles=CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=PTVXQARCLQPGIR-SXUWKVJYSA-L}} |
− | {{#set: common name= | + | {{#set: common name=β-L-fucose 1-phosphate}} |
− | {{#set: produced by= | + | {{#set: molecular weight=242.122 }} |
+ | {{#set: common name=L-Fucose 1-phosphate|6-deoxy-L-galactose 1-phosphate|L-fucopyranose 1-(dihydrogen phosphate)}} | ||
+ | {{#set: consumed by=2.7.7.30-RXN}} | ||
+ | {{#set: produced by=FUCOKINASE-RXN}} |
Latest revision as of 20:02, 21 March 2018
Contents
Metabolite CPD-488
- smiles:
- CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
- inchi key:
- InChIKey=PTVXQARCLQPGIR-SXUWKVJYSA-L
- common name:
- β-L-fucose 1-phosphate
- molecular weight:
- 242.122
- Synonym(s):
- L-Fucose 1-phosphate
- 6-deoxy-L-galactose 1-phosphate
- L-fucopyranose 1-(dihydrogen phosphate)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.