Difference between revisions of "CPD-590"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-3 PWY66-3] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-332...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O) * inchi k...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-3 PWY66-3] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
+
** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O)
 +
* inchi key:
 +
** InChIKey=SBZWTSHAFILOTE-SOUVJXGZSA-N
 
* common name:
 
* common name:
−
** cholesterol biosynthesis II (via 24,25-dihydrolanosterol)
+
** (2R,3S,4S)-leucocyanidin
 +
* molecular weight:
 +
** 306.271   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2,3-trans-3,4-cis-leucocyanidin
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''9''' reactions found over '''22''' reactions in the full pathway
+
* [[RXN-602]]
−
* [[1.14.21.6-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** 1 associated gene(s):
+
* [[RXN-600]]
−
*** [[Ec-01_003780]]
+
== Reaction(s) of unknown directionality ==
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[PWY-5670]]
+
−
** 0 associated gene:
+
−
* [[RXN66-11]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-10_006240]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN66-12]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-10_006240]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN66-13]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-10_006240]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN66-14]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-10_001280]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN66-18]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-21_001850]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN66-23]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-21_001850]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN66-323]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-04_004040]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6132 PWY-6132]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6132 PWY-6132]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-10 RXN66-10]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-15 RXN66-15]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-16 RXN66-16]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-17 RXN66-17]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-19 RXN66-19]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-20 RXN66-20]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-21 RXN66-21]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-22 RXN66-22]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-24 RXN66-24]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-25 RXN66-25]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-33208}}
+
* PUBCHEM:
−
{{#set: common name=cholesterol biosynthesis II (via 24,25-dihydrolanosterol)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440833 440833]
−
{{#set: reaction found=9}}
+
* CHEMSPIDER:
−
{{#set: total reaction=22}}
+
** [http://www.chemspider.com/Chemical-Structure.389677.html 389677]
−
{{#set: completion rate=41.0}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11412 11412]
 +
* METABOLIGHTS : MTBLC11412
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05906 C05906]
 +
{{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O)}}
 +
{{#set: inchi key=InChIKey=SBZWTSHAFILOTE-SOUVJXGZSA-N}}
 +
{{#set: common name=(2R,3S,4S)-leucocyanidin}}
 +
{{#set: molecular weight=306.271    }}
 +
{{#set: common name=2,3-trans-3,4-cis-leucocyanidin}}
 +
{{#set: consumed by=RXN-602}}
 +
{{#set: produced by=RXN-600}}

Latest revision as of 20:00, 21 March 2018

Metabolite CPD-590

  • smiles:
    • C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O)
  • inchi key:
    • InChIKey=SBZWTSHAFILOTE-SOUVJXGZSA-N
  • common name:
    • (2R,3S,4S)-leucocyanidin
  • molecular weight:
    • 306.271
  • Synonym(s):
    • 2,3-trans-3,4-cis-leucocyanidin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-590&oldid=23823"