Difference between revisions of "CPD-659"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_ZN+2 ExchangeSeed_ZN+2] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formu...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-659 CPD-659] == * smiles: ** C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O * common name: **...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-659 CPD-659] == |
− | * | + | * smiles: |
− | ** | + | ** C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O |
+ | * common name: | ||
+ | ** L-arogenate | ||
+ | * inchi key: | ||
+ | ** InChIKey=MIEILDYWGANZNH-DSQUFTABSA-M | ||
+ | * molecular weight: | ||
+ | ** 226.208 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** L-arogenic acid | ||
+ | ** pretyrosine | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[CYCLOHEXADIENYL-DEHYDROGENASE-RXN]] |
− | + | * [[RXN-5682]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-14476]] | |
− | == | + | * [[PREPHENATE-ASP-TRANSAMINE-RXN]] |
− | == | + | * [[PREPHENATE-TRANSAMINE-RXN]] |
− | + | ||
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 53078-86-7 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244469 25244469] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58180 58180] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00826 C00826] | ||
+ | {{#set: smiles=C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O}} | ||
+ | {{#set: common name=L-arogenate}} | ||
+ | {{#set: inchi key=InChIKey=MIEILDYWGANZNH-DSQUFTABSA-M}} | ||
+ | {{#set: molecular weight=226.208 }} | ||
+ | {{#set: common name=L-arogenic acid|pretyrosine}} | ||
+ | {{#set: consumed by=CYCLOHEXADIENYL-DEHYDROGENASE-RXN|RXN-5682}} | ||
+ | {{#set: reversible reaction associated=RXN-14476|PREPHENATE-ASP-TRANSAMINE-RXN|PREPHENATE-TRANSAMINE-RXN}} |
Latest revision as of 20:43, 21 March 2018
Contents
Metabolite CPD-659
- smiles:
- C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O
- common name:
- L-arogenate
- inchi key:
- InChIKey=MIEILDYWGANZNH-DSQUFTABSA-M
- molecular weight:
- 226.208
- Synonym(s):
- L-arogenic acid
- pretyrosine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O" cannot be used as a page name in this wiki.