Difference between revisions of "CPD-659"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] == * smiles: ** CC2(=C(SC(C(C)O)=[N+](CC1(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-659 CPD-659] == * smiles: ** C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O * common name: **...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-659 CPD-659] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** L-arogenate |
+ | * inchi key: | ||
+ | ** InChIKey=MIEILDYWGANZNH-DSQUFTABSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 226.208 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-arogenic acid |
− | ** | + | ** pretyrosine |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[CYCLOHEXADIENYL-DEHYDROGENASE-RXN]] |
+ | * [[RXN-5682]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-14476]] | ||
+ | * [[PREPHENATE-ASP-TRANSAMINE-RXN]] | ||
+ | * [[PREPHENATE-TRANSAMINE-RXN]] | ||
== External links == | == External links == | ||
+ | * CAS : 53078-86-7 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244469 25244469] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58180 58180] |
− | {{#set: smiles | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00826 C00826] |
− | {{#set: | + | {{#set: smiles=C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O}} |
− | {{#set: molecular weight= | + | {{#set: common name=L-arogenate}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=MIEILDYWGANZNH-DSQUFTABSA-M}} |
− | {{#set: consumed by=RXN- | + | {{#set: molecular weight=226.208 }} |
− | {{#set: | + | {{#set: common name=L-arogenic acid|pretyrosine}} |
+ | {{#set: consumed by=CYCLOHEXADIENYL-DEHYDROGENASE-RXN|RXN-5682}} | ||
+ | {{#set: reversible reaction associated=RXN-14476|PREPHENATE-ASP-TRANSAMINE-RXN|PREPHENATE-TRANSAMINE-RXN}} |
Latest revision as of 20:43, 21 March 2018
Contents
Metabolite CPD-659
- smiles:
- C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O
- common name:
- L-arogenate
- inchi key:
- InChIKey=MIEILDYWGANZNH-DSQUFTABSA-M
- molecular weight:
- 226.208
- Synonym(s):
- L-arogenic acid
- pretyrosine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O" cannot be used as a page name in this wiki.