Difference between revisions of "CPD-8122"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11056 RXN-11056] == * direction: ** LEFT-TO-RIGHT * common name: ** Monooxygenase, FAD-binding...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] == * smiles: ** C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11056 RXN-11056] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC=NC2=3))))C5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N)))
 +
* inchi key:
 +
** InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K
 
* common name:
 
* common name:
−
** Monooxygenase, FAD-binding
+
** molybdopterin adenine dinucleotide
−
** Aromatic-ring hydroxylase-like
+
* molecular weight:
−
* ec number:
+
** 721.529   
−
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** adenylated molybdopterin
 +
** H2Dtpp-mADP
 +
** molybdopterin-AMP
 +
** adenylyl-molybdopterin
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-8348]]
−
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[N-ACETYL-5-METHOXY-TRYPTAMINE]][c] '''=>''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[CPD-12014]][c] '''+''' 1 [[WATER]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-8344]]
−
** 1 oxygen[c] '''+''' 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 melatonin[c] '''=>''' 1 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 6-hydroxymelatonin[c] '''+''' 1 H2O[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-00_001320]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Ec-26_003280]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Ec-01_010880]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6398]], melatonin degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6398 PWY-6398]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Monooxygenase, FAD-binding}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53356704 53356704]
−
{{#set: common name=Aromatic-ring hydroxylase-like}}
+
* CHEBI:
−
{{#set: ec number=EC-1.14.14.1}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62727 62727]
−
{{#set: gene associated=Ec-00_001320|Ec-26_003280|Ec-01_010880}}
+
{{#set: smiles=C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC=NC2=3))))C5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N)))}}
−
{{#set: in pathway=PWY-6398}}
+
{{#set: inchi key=InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=molybdopterin adenine dinucleotide}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: molecular weight=721.529    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=adenylated molybdopterin|H2Dtpp-mADP|molybdopterin-AMP|adenylyl-molybdopterin}}
 +
{{#set: consumed by=RXN-8348}}
 +
{{#set: produced by=RXN-8344}}

Latest revision as of 20:58, 21 March 2018

Metabolite CPD-8122

  • smiles:
    • C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC=NC2=3))))C5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N)))
  • inchi key:
    • InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K
  • common name:
    • molybdopterin adenine dinucleotide
  • molecular weight:
    • 721.529
  • Synonym(s):
    • adenylated molybdopterin
    • H2Dtpp-mADP
    • molybdopterin-AMP
    • adenylyl-molybdopterin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=NC3(C(N)=NC=NC2=3))))C5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-8122&oldid=30710"