Difference between revisions of "D-HEXOSE-6-PHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] == * smiles:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-HEXOSE-6-PHOSPHATE D-HEXOSE-6-PHOSPHATE] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-HEXOSE-6-PHOSPHATE D-HEXOSE-6-PHOSPHATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=NBSCHQHZLSJFNQ-UHFFFAOYSA-L |
* common name: | * common name: | ||
− | ** | + | ** D-hexose 6-phosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 258.121 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[HEXOKINASE-RXN]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4459709 4459709] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.3658466.html 3658466] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61567 61567] |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02965 C02965] |
− | {{#set: smiles= | + | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-UHFFFAOYSA-L}} |
− | {{#set: common name= | + | {{#set: common name=D-hexose 6-phosphate}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=258.121 }} |
− | {{#set: | + | {{#set: reversible reaction associated=HEXOKINASE-RXN}} |
− | + | ||
− | + |
Latest revision as of 20:43, 21 March 2018
Contents
Metabolite D-HEXOSE-6-PHOSPHATE
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)
- inchi key:
- InChIKey=NBSCHQHZLSJFNQ-UHFFFAOYSA-L
- common name:
- D-hexose 6-phosphate
- molecular weight:
- 258.121
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.