Difference between revisions of "DISULFOXRED-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == * smiles: ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] * inchi key: **...")
 
(Created page with "Category:Gene == Gene Ec-00_010030 == * left end position: ** 16928311 * transcription direction: ** POSITIVE * right end position: ** 16932332 * centisome position: ** 89...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] ==
+
== Gene Ec-00_010030 ==
−
* smiles:
+
* left end position:
−
** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-]
+
** 16928311
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** L-selenocystathionine
+
** 16932332
−
* molecular weight:
+
* centisome position:
−
** 269.159    
+
** 89.34829    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0772_0002
 +
** Esi0772_0002
 +
** CAT
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12729]]
+
* [[CATAL-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***ec-number
−
* [[RXN-15137]]
+
* [[PEROXID-RXN]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN-14189]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN-14240]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN-15288]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN-17352]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN-8635]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN-8667]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN66-1]]
 +
** esiliculosus_genome
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7214]]
 +
* [[PWY-7445]]
 +
* [[PWY66-162]]
 +
* [[DETOX1-PWY]]
 +
* [[PWY-6824]]
 +
* [[DETOX1-PWY-1]]
 +
* [[PWY-5469]]
 +
* [[PWY-5506]]
 +
* [[PWY-5466]]
 +
* [[PWY-5461]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=16928311}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52921580 52921580]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=16932332}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62226 62226]
+
{{#set: centisome position=89.34829    }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0772_0002|Esi0772_0002|CAT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05699 C05699]
+
{{#set: reaction associated=CATAL-RXN|PEROXID-RXN|RXN-14189|RXN-14240|RXN-15288|RXN-17352|RXN-8635|RXN-8667|RXN66-1}}
−
* HMDB : HMDB06343
+
{{#set: pathway associated=PWY-7214|PWY-7445|PWY66-162|DETOX1-PWY|PWY-6824|DETOX1-PWY-1|PWY-5469|PWY-5506|PWY-5466|PWY-5461}}
−
{{#set: smiles=C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N}}
+
−
{{#set: common name=L-selenocystathionine}}
+
−
{{#set: molecular weight=269.159    }}
+
−
{{#set: consumed by=RXN-12729}}
+
−
{{#set: consumed or produced by=RXN-15137}}
+

Revision as of 22:16, 17 March 2018

Gene Ec-00_010030

  • left end position:
    • 16928311
  • transcription direction:
    • POSITIVE
  • right end position:
    • 16932332
  • centisome position:
    • 89.34829
  • Synonym(s):
    • Esi_0772_0002
    • Esi0772_0002
    • CAT

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=DISULFOXRED-RXN&oldid=12339"