Difference between revisions of "Ec-00 000320"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CMP CMP] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))OP([O-])([O-])=O * inchi key: *...") |
(Created page with "Category:Gene == Gene Ec-00_000320 == * left end position: ** 481107 * transcription direction: ** NEGATIVE * right end position: ** 483306 * centisome position: ** 2.5393...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-00_000320 == |
− | * | + | * left end position: |
− | ** | + | ** 481107 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 483306 |
− | * | + | * centisome position: |
− | ** | + | ** 2.5393014 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_1076_0002 |
− | ** | + | ** Esi1076_0002 |
− | ** | + | ** GST |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[GSHTRAN-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: ec-number | |
− | * [[RXN | + | * Reaction: [[GST-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[RXN-13673]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[RXN-15680]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: ec-number |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[PWY-7112]] |
− | * [[ | + | * [[PWY-6842]] |
+ | * [[PWY-4061]] | ||
+ | * [[PWY-7533]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=481107}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=483306}} | |
− | + | {{#set: centisome position=2.5393014 }} | |
− | + | {{#set: common name=Esi_1076_0002|Esi1076_0002|GST}} | |
− | + | {{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}} | |
− | + | {{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 20:01, 21 March 2018
Gene Ec-00_000320
- left end position:
- 481107
- transcription direction:
- NEGATIVE
- right end position:
- 483306
- centisome position:
- 2.5393014
- Synonym(s):
- Esi_1076_0002
- Esi1076_0002
- GST
Reactions associated
- Reaction: GSHTRAN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: GST-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-13673
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-15680
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome