Difference between revisions of "Ec-00 002820"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2961 CPD-2961] == * smiles: ** C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-00_002820 == * left end position: ** 2966265 * transcription direction: ** NEGATIVE * right end position: ** 2967622 * centisome position: ** 15.6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-00_002820 == |
− | * | + | * left end position: |
− | ** | + | ** 2966265 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2967622 |
− | * | + | * centisome position: |
− | ** | + | ** 15.656061 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_1678_0001 |
− | ** | + | ** Esi1678_0001 |
− | ** | + | ** CBL2, C-term |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[CYSTATHIONINE-BETA-LYASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[RXN- | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[RXN-12729]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | * Reaction: [[RXN-15131]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-15137]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[HOMOSER-METSYN-PWY]] | ||
+ | * [[PWY-801]] | ||
+ | * [[PWY-6936]] | ||
+ | * [[PWY-702]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2966265}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2967622}} | |
− | + | {{#set: centisome position=15.656061 }} | |
− | + | {{#set: common name=Esi_1678_0001|Esi1678_0001|CBL2, C-term}} | |
− | + | {{#set: reaction associated=CYSTATHIONINE-BETA-LYASE-RXN|RXN-12729|RXN-15131|RXN-15137}} | |
− | + | {{#set: pathway associated=HOMOSER-METSYN-PWY|PWY-801|PWY-6936|PWY-702}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:28, 21 March 2018
Gene Ec-00_002820
- left end position:
- 2966265
- transcription direction:
- NEGATIVE
- right end position:
- 2967622
- centisome position:
- 15.656061
- Synonym(s):
- Esi_1678_0001
- Esi1678_0001
- CBL2, C-term
Reactions associated
- Reaction: CYSTATHIONINE-BETA-LYASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-12729
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-15131
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-15137
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome