Difference between revisions of "Ec-00 006960"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] == * smiles: ** CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14192 RXN-14192] == * direction: ** REVERSIBLE * common name: ** Pyruvate kinase, barrel ** Pyr...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14192 RXN-14192] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Pyruvate kinase, barrel |
− | * | + | ** Pyruvate kinase, alpha/beta |
− | ** | + | ** pyruvate kinase |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/2.7.1.40 EC-2.7.1.40] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[PYRUVATE]][c] '''+''' 1 [[DATP]][c] '''<=>''' 1 [[PHOSPHO-ENOL-PYRUVATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[DADP]][c] | |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 pyruvate[c] '''+''' 1 dATP[c] '''<=>''' 1 phosphoenolpyruvate[c] '''+''' 1 H+[c] '''+''' 1 dADP[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-12_000950]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-06_006860]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-26_004170]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30730 30730] | |
− | + | * LIGAND-RXN: | |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01138 R01138] |
− | * LIGAND- | + | {{#set: direction=REVERSIBLE}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=Pyruvate kinase, barrel}} |
− | + | {{#set: common name=Pyruvate kinase, alpha/beta}} | |
− | {{#set: | + | {{#set: common name=pyruvate kinase}} |
− | {{#set: | + | {{#set: ec number=EC-2.7.1.40}} |
− | {{#set: common name= | + | {{#set: gene associated=Ec-12_000950|Ec-06_006860|Ec-26_004170}} |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 14:12, 21 March 2018
Contents
Reaction RXN-14192
- direction:
- REVERSIBLE
- common name:
- Pyruvate kinase, barrel
- Pyruvate kinase, alpha/beta
- pyruvate kinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PYRUVATE[c] + 1 DATP[c] <=> 1 PHOSPHO-ENOL-PYRUVATE[c] + 1 PROTON[c] + 1 DADP[c]
- With common name(s):
- 1 pyruvate[c] + 1 dATP[c] <=> 1 phosphoenolpyruvate[c] + 1 H+[c] + 1 dADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-12_000950
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-06_006860
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-26_004170
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links