Difference between revisions of "Ec-00 006960"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] == * smiles: ** CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: ** InChIKe...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6538 PWY-6538] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
 +
* inchi key:
 +
** InChIKey=PTVXQARCLQPGIR-SXUWKVJYSA-L
 
* common name:
 
* common name:
−
** caffeine degradation III (bacteria, via demethylation)
+
** β-L-fucose 1-phosphate
 +
* molecular weight:
 +
** 242.122   
 
* Synonym(s):
 
* Synonym(s):
−
** caffeine degradation (bacteria)
+
** L-Fucose 1-phosphate
 +
** 6-deoxy-L-galactose 1-phosphate
 +
** L-fucopyranose 1-(dihydrogen phosphate)
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''2''' reactions found over '''7''' reactions in the full pathway
+
* [[2.7.7.30-RXN]]
−
* [[RXN0-901]]
+
== Reaction(s) known to produce the compound ==
−
* [[XANTHINE-OXIDASE-RXN]]
+
* [[FUCOKINASE-RXN]]
−
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11513 RXN-11513]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11516 RXN-11516]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11517 RXN-11517]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11518 RXN-11518]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13106 RXN-13106]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-MAP:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?map00232 map00232]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266535 45266535]
−
* UM-BBD-PWY : caf
+
* CHEBI:
−
{{#set: taxonomic range=TAX-2}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57268 57268]
−
{{#set: common name=caffeine degradation III (bacteria, via demethylation)}}
+
* LIGAND-CPD:
−
{{#set: common name=caffeine degradation (bacteria)}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02985 C02985]
−
{{#set: reaction found=2}}
+
* HMDB : HMDB01265
−
{{#set: reaction not found=7}}
+
{{#set: smiles=CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}}
−
{{#set: completion rate=29.0}}
+
{{#set: inchi key=InChIKey=PTVXQARCLQPGIR-SXUWKVJYSA-L}}
 +
{{#set: common name=β-L-fucose 1-phosphate}}
 +
{{#set: molecular weight=242.122    }}
 +
{{#set: common name=L-Fucose 1-phosphate|6-deoxy-L-galactose 1-phosphate|L-fucopyranose 1-(dihydrogen phosphate)}}
 +
{{#set: consumed by=2.7.7.30-RXN}}
 +
{{#set: produced by=FUCOKINASE-RXN}}

Revision as of 21:27, 17 March 2018

Metabolite CPD-488

  • smiles:
    • CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
  • inchi key:
    • InChIKey=PTVXQARCLQPGIR-SXUWKVJYSA-L
  • common name:
    • β-L-fucose 1-phosphate
  • molecular weight:
    • 242.122
  • Synonym(s):
    • L-Fucose 1-phosphate
    • 6-deoxy-L-galactose 1-phosphate
    • L-fucopyranose 1-(dihydrogen phosphate)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-00_006960&oldid=8998"