Difference between revisions of "Ec-00 008220"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SECOLOGANIN-CPD SECOLOGANIN-CPD] == * smiles: ** C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)...")
(Created page with "Category:Gene == Gene Ec-00_008220 == * left end position: ** 13635296 * transcription direction: ** NEGATIVE * right end position: ** 13637643 * centisome position: ** 71...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SECOLOGANIN-CPD SECOLOGANIN-CPD] ==
+
== Gene Ec-00_008220 ==
−
* smiles:
+
* left end position:
−
** C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)C(O)C(O)C(O)2))
+
** 13635296
−
* inchi key:
+
* transcription direction:
−
** InChIKey=CSKKDSFETGLMSB-NRZPKYKESA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** secologanin
+
** 13637643
−
* molecular weight:
+
* centisome position:
−
** 388.371    
+
** 71.96762    
 
* Synonym(s):
 
* Synonym(s):
−
** (-)-secologanin
+
** Esi_0612_0001
 +
** Esi0612_0001
 +
** CAT fragment
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[STRICTOSIDINE-SYNTHASE-RXN]]
+
* Reaction: [[PEROXID-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
* Reaction: [[RXN-14240]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-15288]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-17352]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-8635]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7214]]
 +
* [[PWY-6824]]
 +
* [[PWY-7445]]
 +
* [[PWY-5469]]
 +
* [[PWY-5466]]
 +
* [[PWY-5461]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0102070002
+
{{#set: left end position=13635296}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=161276 161276]
+
{{#set: right end position=13637643}}
−
* CHEMSPIDER:
+
{{#set: centisome position=71.96762   }}
−
** [http://www.chemspider.com/Chemical-Structure.141670.html 141670]
+
{{#set: common name=Esi_0612_0001|Esi0612_0001|CAT fragment}}
−
* CHEBI:
+
{{#set: reaction associated=PEROXID-RXN|RXN-14240|RXN-15288|RXN-17352|RXN-8635}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18002 18002]
+
{{#set: pathway associated=PWY-7214|PWY-6824|PWY-7445|PWY-5469|PWY-5466|PWY-5461}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01852 C01852]
+
−
{{#set: smiles=C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)C(O)C(O)C(O)2))}}
+
−
{{#set: inchi key=InChIKey=CSKKDSFETGLMSB-NRZPKYKESA-N}}
+
−
{{#set: common name=secologanin}}
+
−
{{#set: molecular weight=388.371   }}
+
−
{{#set: common name=(-)-secologanin}}
+
−
{{#set: consumed by=STRICTOSIDINE-SYNTHASE-RXN}}
+

Latest revision as of 20:38, 21 March 2018

Gene Ec-00_008220

  • left end position:
    • 13635296
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 13637643
  • centisome position:
    • 71.96762
  • Synonym(s):
    • Esi_0612_0001
    • Esi0612_0001
    • CAT fragment

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-00_008220&oldid=28394"