Difference between revisions of "Ec-00 008890"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-20_004180 == * left end position: ** 4367532 * transcription direction: ** POSITIVE * right end position: ** 4380177 * centisome position: ** 84.7...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-20_004180 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] ==
−
* left end position:
+
* smiles:
−
** 4367532
+
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J
−
* right end position:
+
* common name:
−
** 4380177
+
** XTP
−
* centisome position:
+
* molecular weight:
−
** 84.70084    
+
** 520.136    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0010_0135
+
** xanthosine 5' triphosphate
−
** Esi0010_0135
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ATPASE-RXN]]
+
* [[RXN0-1603]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***go-term
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4367532}}
+
* LIGAND-CPD:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00700 C00700]
−
{{#set: right end position=4380177}}
+
* CHEBI:
−
{{#set: centisome position=84.70084   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61314 61314]
−
{{#set: common name=Esi_0010_0135|Esi0010_0135}}
+
* BIGG : 35735
−
{{#set: reaction associated=ATPASE-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245622 25245622]
 +
* HMDB : HMDB00293
 +
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))}}
 +
{{#set: inchi key=InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J}}
 +
{{#set: common name=XTP}}
 +
{{#set: molecular weight=520.136   }}
 +
{{#set: common name=xanthosine 5' triphosphate}}
 +
{{#set: consumed by=RXN0-1603}}

Revision as of 22:52, 17 March 2018

Metabolite XTP

  • smiles:
    • C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))
  • inchi key:
    • InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J
  • common name:
    • XTP
  • molecular weight:
    • 520.136
  • Synonym(s):
    • xanthosine 5' triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-00_008890&oldid=14854"