Difference between revisions of "Ec-00 010010"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FATTY-ACYL-COA-SYNTHASE-RXN FATTY-ACYL-COA-SYNTHASE-RXN] == * direction: ** REVERSIBLE * ec number:...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * inchi key: ** In...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=FATTY-ACYL-COA-SYNTHASE-RXN FATTY-ACYL-COA-SYNTHASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
+
** InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N
 +
* common name:
 +
** serotonin O-sulfate
 +
* molecular weight:
 +
** 256.276   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-hydroxytryptamine O-sulfate
 +
** 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate
 +
** 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ACETYL-COA]][c] '''+''' 2n [[NADPH]][c] '''+''' n [[MALONYL-COA]][c] '''+''' 4n [[PROTON]][c] '''<=>''' n [[CO-A]][c] '''+''' n [[CARBON-DIOXIDE]][c] '''+''' 2n [[NADP]][c] '''+''' 1 [[Long-Chain-Acyl-CoAs]][c]
+
* [[RXN-10777]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 acetyl-CoA[c] '''+''' 2n NADPH[c] '''+''' n malonyl-CoA[c] '''+''' 4n H+[c] '''<=>''' n coenzyme A[c] '''+''' n CO2[c] '''+''' 2n NADP+[c] '''+''' 1 a long-chain acyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-5970]], fatty acids biosynthesis (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5970 PWY-5970]
+
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[gap-filling]]
+
−
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
−
*** Tool: [[meneco]]
+
−
**** Comment: [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R05190 R05190]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=152151 152151]
−
* UNIPROT:
+
* CHEMSPIDER:
−
** [http://www.uniprot.org/uniprot/P34229 P34229]
+
** [http://www.chemspider.com/Chemical-Structure.134104.html 134104]
−
** [http://www.uniprot.org/uniprot/P07149 P07149]
+
{{#set: smiles=C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))}}
−
** [http://www.uniprot.org/uniprot/P34731 P34731]
+
{{#set: inchi key=InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N}}
−
** [http://www.uniprot.org/uniprot/Q9UUG0 Q9UUG0]
+
{{#set: common name=serotonin O-sulfate}}
−
{{#set: direction=REVERSIBLE}}
+
{{#set: molecular weight=256.276    }}
−
{{#set: ec number=EC-2.3.1.86}}
+
{{#set: common name=5-hydroxytryptamine O-sulfate|3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate|1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)}}
−
{{#set: in pathway=PWY-5970}}
+
{{#set: produced by=RXN-10777}}
−
{{#set: reconstruction category=gap-filling}}
+
−
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
+
−
{{#set: reconstruction tool=meneco}}
+
−
{{#set: reconstruction comment=added for gapfilling}}
+

Revision as of 14:57, 21 March 2018

Metabolite CPD-11665

  • smiles:
    • C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))
  • inchi key:
    • InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N
  • common name:
    • serotonin O-sulfate
  • molecular weight:
    • 256.276
  • Synonym(s):
    • 5-hydroxytryptamine O-sulfate
    • 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate
    • 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-00_010010&oldid=23103"