Difference between revisions of "Ec-00 010010"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Ec-00_010010 == * left end position: ** 16910323 * transcription direction: ** NEGATIVE * right end position: ** 16923040 * centisome position: ** 89...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-00_010010 == |
− | * | + | * left end position: |
− | ** | + | ** 16910323 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 16923040 |
− | * | + | * centisome position: |
− | ** | + | ** 89.25334 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0771_0003 |
− | ** | + | ** Esi0771_0003 |
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[GALACTURIDYLYLTRANS-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY-6317]] | ||
+ | * [[PWY66-422]] | ||
+ | * [[PWY-6527]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=16910323}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=16923040}} | |
− | + | {{#set: centisome position=89.25334 }} | |
− | {{#set: | + | {{#set: common name=Esi_0771_0003|Esi0771_0003}} |
− | {{#set: | + | {{#set: reaction associated=GALACTURIDYLYLTRANS-RXN}} |
− | {{#set: | + | {{#set: pathway associated=PWY-6317|PWY66-422|PWY-6527}} |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:58, 21 March 2018
Gene Ec-00_010010
- left end position:
- 16910323
- transcription direction:
- NEGATIVE
- right end position:
- 16923040
- centisome position:
- 89.25334
- Synonym(s):
- Esi_0771_0003
- Esi0771_0003
Reactions associated
- Reaction: GALACTURIDYLYLTRANS-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome