Difference between revisions of "Ec-00 011490"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-724 RXN0-724] == * direction: ** LEFT-TO-RIGHT * common name: ** ribonucleoside-triphosphate r...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-36 CPD-36] == * smiles: ** CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2) * inc...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-724 RXN0-724] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-36 CPD-36] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)
 +
* inchi key:
 +
** InChIKey=DLGJWSVWTWEWBJ-ZTVLJYEESA-M
 
* common name:
 
* common name:
** ribonucleoside-triphosphate reductase
+
** 4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl-D-galactosamine
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/1.17.4.2 EC-1.17.4.2]
+
** 378.312   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4-deoxy-Δ4,5-β-D-GlcAp-(1→3)-β-D-GalNAc
 +
** 3-(4-deoxy-α-L-threo-hex-4-enopyranosyluronic acid)-2-acetamido-2-deoxy-D-galactose
 +
** 3-(4-deoxy-β-D-gluc-4-enuronosyl)-N-acetyl-D-galactosamine
 +
** chondroitin disaccharide (unsulfated)
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-12178]]
** 1 [[Reduced-flavodoxins]][c] '''+''' 1 [[UTP]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[Oxidized-flavodoxins]][c] '''+''' 1 [[DUTP]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 a reduced flavodoxin[c] '''+''' 1 UTP[c] '''=>''' 1 H2O[c] '''+''' 1 an oxidized flavodoxin[c] '''+''' 1 dUTP[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-04_006460]]
+
** ESILICULOSUS_GENOME
+
***GO-TERM
+
== Pathways  ==
+
* [[PWY-7187]], pyrimidine deoxyribonucleotides de novo biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7187 PWY-7187]
+
** '''6''' reactions found over '''7''' reactions in the full pathway
+
* [[PWY0-166]], superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-166 PWY0-166]
+
** '''14''' reactions found over '''17''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=ribonucleoside-triphosphate reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878429 46878429]
{{#set: ec number=EC-1.17.4.2}}
+
* CHEBI:
{{#set: gene associated=Ec-04_006460}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57850 57850]
{{#set: in pathway=PWY-7187|PWY0-166}}
+
* LIGAND-CPD:
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01310 C01310]
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: smiles=CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=DLGJWSVWTWEWBJ-ZTVLJYEESA-M}}
 +
{{#set: common name=4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl-D-galactosamine}}
 +
{{#set: molecular weight=378.312    }}
 +
{{#set: common name=4-deoxy-Δ4,5-β-D-GlcAp-(1→3)-β-D-GalNAc|3-(4-deoxy-α-L-threo-hex-4-enopyranosyluronic acid)-2-acetamido-2-deoxy-D-galactose|3-(4-deoxy-β-D-gluc-4-enuronosyl)-N-acetyl-D-galactosamine|chondroitin disaccharide (unsulfated)}}
 +
{{#set: consumed by=RXN-12178}}

Revision as of 14:51, 21 March 2018

Metabolite CPD-36

  • smiles:
    • CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)
  • inchi key:
    • InChIKey=DLGJWSVWTWEWBJ-ZTVLJYEESA-M
  • common name:
    • 4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl-D-galactosamine
  • molecular weight:
    • 378.312
  • Synonym(s):
    • 4-deoxy-Δ4,5-β-D-GlcAp-(1→3)-β-D-GalNAc
    • 3-(4-deoxy-α-L-threo-hex-4-enopyranosyluronic acid)-2-acetamido-2-deoxy-D-galactose
    • 3-(4-deoxy-β-D-gluc-4-enuronosyl)-N-acetyl-D-galactosamine
    • chondroitin disaccharide (unsulfated)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)" cannot be used as a page name in this wiki.