Difference between revisions of "Ec-01 002340"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)...")
 
(Created page with "Category:Gene == Gene Ec-01_002340 == * left end position: ** 1962618 * transcription direction: ** NEGATIVE * right end position: ** 1967787 * centisome position: ** 19.0...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] ==
+
== Gene Ec-01_002340 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))
+
** 1962618
−
* inchi key:
+
* transcription direction:
−
** InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
+
** 1967787
−
* molecular weight:
+
* centisome position:
−
** 427.646    
+
** 19.019764    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0003_0065
 +
** Esi0003_0065
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-318]]
+
* Reaction: [[1.11.1.15-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
* Reaction: [[RXN0-5468]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1962618}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659076 90659076]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: right end position=1967787}}
−
{{#set: inchi key=InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M}}
+
{{#set: centisome position=19.019764    }}
−
{{#set: common name=4α-carboxy-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: common name=Esi_0003_0065|Esi0003_0065}}
−
{{#set: molecular weight=427.646    }}
+
{{#set: reaction associated=1.11.1.15-RXN|RXN0-5468}}
−
{{#set: consumed by=RXN66-318}}
+

Latest revision as of 20:33, 21 March 2018

Gene Ec-01_002340

  • left end position:
    • 1962618
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1967787
  • centisome position:
    • 19.019764
  • Synonym(s):
    • Esi_0003_0065
    • Esi0003_0065

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_002340&oldid=27772"