Difference between revisions of "Ec-01 002780"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2)) * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-01_002780 == * Synonym(s): ** Esi_0003_0136 ** Esi0003_0136 == Reactions associated == * Reaction: TRANSALDOL-RXN ** Source: orthology-arag...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_002780 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0003_0136 |
+ | ** Esi0003_0136 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[TRANSALDOL-RXN]] | |
− | * [[ | + | ** Source: [[orthology-aragem]] |
− | == | + | ** Source: [[orthology-aragem]] |
+ | == Pathways associated == | ||
+ | * [[P124-PWY]] | ||
+ | * [[P185-PWY]] | ||
+ | * [[PWY-5723]] | ||
+ | * [[PWY-1861]] | ||
+ | * [[NONOXIPENT-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0003_0136|Esi0003_0136}} | |
− | + | {{#set: reaction associated=TRANSALDOL-RXN}} | |
− | + | {{#set: pathway associated=P124-PWY|P185-PWY|PWY-5723|PWY-1861|NONOXIPENT-PWY}} | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:27, 21 March 2018
Gene Ec-01_002780
- Synonym(s):
- Esi_0003_0136
- Esi0003_0136
Reactions associated
- Reaction: TRANSALDOL-RXN
- Source: orthology-aragem
- Source: orthology-aragem