Difference between revisions of "Ec-01 003960"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] == * smiles: ** [CH](=O)CCCC([N+])C(=O)[O-] * inchi key: ** InChIKey=GFXYTQP...")
 
(Created page with "Category:Gene == Gene Ec-01_003960 == * left end position: ** 3306866 * transcription direction: ** POSITIVE * right end position: ** 3310854 * centisome position: ** 32.0...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] ==
+
== Gene Ec-01_003960 ==
−
* smiles:
+
* left end position:
−
** [CH](=O)CCCC([N+])C(=O)[O-]
+
** 3306866
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GFXYTQPNNXGICT-YFKPBYRVSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (S)-2-amino-6-oxohexanoate
+
** 3310854
−
* molecular weight:
+
* centisome position:
−
** 145.158    
+
** 32.046898    
 
* Synonym(s):
 
* Synonym(s):
−
** allysine
+
** Esi_0003_0345
−
** L-2-aminoadipate 6-semialdehyde
+
** Esi0003_0345
−
** 2-aminoadipate 6-semialdehyde
+
** GPAT
−
** α-aminoadipate 6-semialdehyde
+
−
** 2-aminoadipate semialdehyde
+
−
** L-allysine
+
−
** (S)-2-aminoadipate 6-semialdehyde
+
−
** 2-aminoadipate-6-semialdehyde
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.2.1.31-RXN]]
+
* Reaction: [[RXN-10462]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[1.5.1.9-RXN]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-13805]]
−
* [[RXN-8173]]
+
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-1381]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15045]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16024]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16117]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17016]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17017]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17018]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[TRIGLSYN-PWY]]
 +
* [[PWY-5667]]
 +
* [[PWY0-1319]]
 +
* [[PWY-7411]]
 +
* [[PWY-7587]]
 +
* [[PWY-6453]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1962-83-0
+
{{#set: left end position=3306866}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688062 36688062]
+
{{#set: right end position=3310854}}
−
* HMDB : HMDB59595
+
{{#set: centisome position=32.046898   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0003_0345|Esi0003_0345|GPAT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04076 C04076]
+
{{#set: reaction associated=RXN-10462|RXN-13805|RXN-1381|RXN-15045|RXN-16024|RXN-16117|RXN-17016|RXN-17017|RXN-17018}}
−
* CHEBI:
+
{{#set: pathway associated=TRIGLSYN-PWY|PWY-5667|PWY0-1319|PWY-7411|PWY-7587|PWY-6453}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58321 58321]
+
−
* METABOLIGHTS : MTBLC58321
+
−
{{#set: smiles=[CH](=O)CCCC([N+])C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=GFXYTQPNNXGICT-YFKPBYRVSA-N}}
+
−
{{#set: common name=(S)-2-amino-6-oxohexanoate}}
+
−
{{#set: molecular weight=145.158   }}
+
−
{{#set: common name=allysine|L-2-aminoadipate 6-semialdehyde|2-aminoadipate 6-semialdehyde|α-aminoadipate 6-semialdehyde|2-aminoadipate semialdehyde|L-allysine|(S)-2-aminoadipate 6-semialdehyde|2-aminoadipate-6-semialdehyde}}
+
−
{{#set: consumed by=1.2.1.31-RXN}}
+
−
{{#set: produced by=1.5.1.9-RXN}}
+
−
{{#set: consumed or produced by=RXN-8173}}
+

Latest revision as of 20:20, 21 March 2018

Gene Ec-01_003960

  • left end position:
    • 3306866
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3310854
  • centisome position:
    • 32.046898
  • Synonym(s):
    • Esi_0003_0345
    • Esi0003_0345
    • GPAT

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_003960&oldid=26193"