Difference between revisions of "Ec-02 004960"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE_DIPHOSPHATE_RIBOSE ADENOSINE_DIPHOSPHATE_RIBOSE] == * smiles: ** C(C3(C(C(C(N2(C1(=C(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Octenoyl-ACPs 2-Octenoyl-ACPs] == * common name: ** a trans oct-2-enoyl-[acp] * Synonym(s): *...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE_DIPHOSPHATE_RIBOSE ADENOSINE_DIPHOSPHATE_RIBOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Octenoyl-ACPs 2-Octenoyl-ACPs] ==
−
* smiles:
+
−
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C(O)C(O4)O))([O-])=O
+
−
* inchi key:
+
−
** InChIKey=SRNWOUGRCWSEMX-TYASJMOZSA-L
+
 
* common name:
 
* common name:
−
** ADP-D-ribose
+
** a trans oct-2-enoyl-[acp]
−
* molecular weight:
+
−
** 557.303   
+
 
* Synonym(s):
 
* Synonym(s):
−
** adenosine diphosphate D-ribose
+
** a trans-oct-2-enoyl-[acp]
−
** adenosine 5'-(5-deoxy-D-ribofuranos-5-yl diphosphate)
+
** a trans-oct-2-enoyl-[acyl-carrier protein]
 +
** (2E)-octenoyl-[acp]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN0-1441]]
+
* [[RXN-9659]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10034]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 20762-30-5
+
{{#set: common name=a trans oct-2-enoyl-[acp]}}
−
* BIGG : 34547
+
{{#set: common name=a trans-oct-2-enoyl-[acp]|a trans-oct-2-enoyl-[acyl-carrier protein]|(2E)-octenoyl-[acp]}}
−
* PUBCHEM:
+
{{#set: consumed by=RXN-9659}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791958 49791958]
+
−
* HMDB : HMDB01178
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00301 C00301]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57967 57967]
+
−
* METABOLIGHTS : MTBLC57967
+
−
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C(O)C(O4)O))([O-])=O}}
+
−
{{#set: inchi key=InChIKey=SRNWOUGRCWSEMX-TYASJMOZSA-L}}
+
−
{{#set: common name=ADP-D-ribose}}
+
−
{{#set: molecular weight=557.303    }}
+
−
{{#set: common name=adenosine diphosphate D-ribose|adenosine 5'-(5-deoxy-D-ribofuranos-5-yl diphosphate)}}
+
−
{{#set: consumed by=RXN0-1441}}
+
−
{{#set: produced by=RXN-10034}}
+

Revision as of 14:50, 21 March 2018

Metabolite 2-Octenoyl-ACPs

  • common name:
    • a trans oct-2-enoyl-[acp]
  • Synonym(s):
    • a trans-oct-2-enoyl-[acp]
    • a trans-oct-2-enoyl-[acyl-carrier protein]
    • (2E)-octenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a trans oct-2-enoyl-[acp" cannot be used as a page name in this wiki.
  • "a trans-oct-2-enoyl-[acp" cannot be used as a page name in this wiki.
  • "a trans-oct-2-enoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
  • "(2E)-octenoyl-[acp" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-02_004960&oldid=22037"