Difference between revisions of "Ec-03 002180"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] == * smiles: ** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=...")
(Created page with "Category:Gene == Gene Ec-03_002180 == * left end position: ** 2663850 * transcription direction: ** POSITIVE * right end position: ** 2672990 * centisome position: ** 40.8...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] ==
+
== Gene Ec-03_002180 ==
−
* smiles:
+
* left end position:
−
** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)
+
** 2663850
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** pelargonidin-3,5-di-O-β-D-glucoside
+
** 2672990
−
* molecular weight:
+
* centisome position:
−
** 594.525    
+
** 40.802395    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0011_0107
 +
** Esi0011_0107
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.5.1.20-RXN]]
−
* [[RXN-7828]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-2201]]
 +
* [[1CMET2-PWY]]
 +
* [[CODH-PWY]]
 +
* [[PWY-3841]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2663850}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167643 167643]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2672990}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57503 57503]
+
{{#set: centisome position=40.802395    }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0011_0107|Esi0011_0107}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08725 C08725]
+
{{#set: reaction associated=1.5.1.20-RXN}}
−
* HMDB : HMDB33681
+
{{#set: pathway associated=PWY-2201|1CMET2-PWY|CODH-PWY|PWY-3841}}
−
{{#set: smiles=C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)}}
+
−
{{#set: inchi key=InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N}}
+
−
{{#set: common name=pelargonidin-3,5-di-O-β-D-glucoside}}
+
−
{{#set: molecular weight=594.525    }}
+
−
{{#set: produced by=RXN-7828}}
+

Latest revision as of 20:56, 21 March 2018

Gene Ec-03_002180

  • left end position:
    • 2663850
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2672990
  • centisome position:
    • 40.802395
  • Synonym(s):
    • Esi_0011_0107
    • Esi0011_0107

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-03_002180&oldid=30377"