Difference between revisions of "Ec-04 001540"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] == * smiles: ** C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5951 PWY-5951] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5951 PWY-5951] ==
−
* smiles:
+
* taxonomic range:
−
** C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 5-hydroxyindole acetate
+
** (R,R)-butanediol biosynthesis
−
* molecular weight:
+
−
** 190.178   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5-hydroxyindoleacetic acid
+
** (R,R)-butylene glycol fermentation
 +
** (R,R)-butanediol fermentation
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''1''' reactions in the full pathway
−
* [[RXN-10780]]
+
* [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-16_002060]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 54-16-0
+
{{#set: taxonomic range=TAX-4751}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3772821 3772821]
+
{{#set: common name=(R,R)-butanediol biosynthesis}}
−
* HMDB : HMDB00763
+
{{#set: common name=(R,R)-butylene glycol fermentation|(R,R)-butanediol fermentation}}
−
* LIGAND-CPD:
+
{{#set: reaction found=1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05635 C05635]
+
{{#set: total reaction=1}}
−
* CHEMSPIDER:
+
{{#set: completion rate=100.0}}
−
** [http://www.chemspider.com/Chemical-Structure.3001356.html 3001356]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62622 62622]
+
−
{{#set: smiles=C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))}}
+
−
{{#set: inchi key=InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M}}
+
−
{{#set: common name=5-hydroxyindole acetate}}
+
−
{{#set: molecular weight=190.178    }}
+
−
{{#set: common name=5-hydroxyindoleacetic acid}}
+
−
{{#set: produced by=RXN-10780}}
+

Revision as of 21:45, 17 March 2018

Pathway PWY-5951

  • taxonomic range:
  • common name:
    • (R,R)-butanediol biosynthesis
  • Synonym(s):
    • (R,R)-butylene glycol fermentation
    • (R,R)-butanediol fermentation

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-04_001540&oldid=10233"