Difference between revisions of "Ec-04 003810"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6855 PWY-6855] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
 +
* inchi key:
 +
** InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N
 
* common name:
 
* common name:
−
** chitin degradation I (archaea)
+
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
 +
* molecular weight:
 +
** 444.74   
 
* Synonym(s):
 
* Synonym(s):
−
** chitin degradation (archaea)
 
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''6''' reactions in the full pathway
+
* [[RXN66-12]]
−
* [[RXN-12554]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) not found ==
+
* [[RXN66-11]]
−
* [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSAMINE-6-P-DEAMIN-RXN GLUCOSAMINE-6-P-DEAMIN-RXN]
+
== Reaction(s) of unknown directionality ==
−
* [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYLGLUCOSAMINE-DEACETYLASE-RXN N-ACETYLGLUCOSAMINE-DEACETYLASE-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12543 RXN-12543]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12544 RXN-12544]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12545 RXN-12545]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2157}}
+
* PUBCHEM:
−
{{#set: common name=chitin degradation I (archaea)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201302 25201302]
−
{{#set: common name=chitin degradation (archaea)}}
+
* HMDB : HMDB12160
−
{{#set: reaction found=1}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
−
{{#set: reaction not found=6}}
+
{{#set: inchi key=InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N}}
−
{{#set: completion rate=17.0}}
+
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol}}
 +
{{#set: molecular weight=444.74    }}
 +
{{#set: consumed by=RXN66-12}}
 +
{{#set: produced by=RXN66-11}}

Revision as of 21:33, 17 March 2018

Metabolite CPD-8607

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
  • inchi key:
    • InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N
  • common name:
    • 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
  • molecular weight:
    • 444.74
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-04_003810&oldid=9372"