Difference between revisions of "Ec-05 001250"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Ec-05_001250 == * left end position: ** 2439615 * transcription direction: ** NEGATIVE * right end position: ** 2457446 * centisome position: ** 26.7...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-05_001250 == |
− | * | + | * left end position: |
− | ** | + | ** 2439615 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2457446 |
− | * | + | * centisome position: |
− | ** | + | ** 26.798635 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0293_0005 |
+ | ** Esi0293_0005 | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[2.7.1.68-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | ** Source: [[orthology-aragem]] |
+ | == Pathways associated == | ||
+ | * [[PWY-6352]] | ||
+ | * [[PWY-6351]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2439615}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | {{#set: | + | {{#set: right end position=2457446}} |
− | {{#set: | + | {{#set: centisome position=26.798635 }} |
− | {{#set: | + | {{#set: common name=Esi_0293_0005|Esi0293_0005}} |
− | {{#set: | + | {{#set: reaction associated=2.7.1.68-RXN}} |
− | {{#set: common name= | + | {{#set: pathway associated=PWY-6352|PWY-6351}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:29, 21 March 2018
Gene Ec-05_001250
- left end position:
- 2439615
- transcription direction:
- NEGATIVE
- right end position:
- 2457446
- centisome position:
- 26.798635
- Synonym(s):
- Esi_0293_0005
- Esi0293_0005
Reactions associated
- Reaction: 2.7.1.68-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome