Difference between revisions of "Ec-05 006220"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17024 RXN-17024] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acyl-sn-glycerol-3-phosph...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == * smiles: ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) * inchi key...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17024 RXN-17024] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))
 +
* inchi key:
 +
** InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N
 
* common name:
 
* common name:
−
** 1-acyl-sn-glycerol-3-phosphate acyltransferase
+
** D-galactosylononitol
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.3.1.51 EC-2.3.1.51]
+
** 356.326   
 
* Synonym(s):
 
* Synonym(s):
 +
** galactosyl sequoyitol
 +
** O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[1-PALMITOYLGLYCEROL-3-PHOSPHATE]][c] '''+''' 1 [[Myristoyl-ACPs]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[CPD-18390]][c]
+
* [[RXN-8281]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 1-palmitoylglycerol 3-phosphate[c] '''+''' 1 a myristoyl-[acp][c] '''=>''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 1-palmitoyl-2-myristoyl phosphatidate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-26_001280]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-12_004670]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-21_003240]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-02_006160]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=1-acyl-sn-glycerol-3-phosphate acyltransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202605 25202605]
−
{{#set: ec number=EC-2.3.1.51}}
+
{{#set: smiles=COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))}}
−
{{#set: gene associated=Ec-26_001280|Ec-12_004670|Ec-21_003240|Ec-02_006160}}
+
{{#set: inchi key=InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N}}
−
{{#set: in pathway=}}
+
{{#set: common name=D-galactosylononitol}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=356.326    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=galactosyl sequoyitol|O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: produced by=RXN-8281}}

Revision as of 21:35, 17 March 2018

Metabolite CPD-8058

  • smiles:
    • COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))
  • inchi key:
    • InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N
  • common name:
    • D-galactosylononitol
  • molecular weight:
    • 356.326
  • Synonym(s):
    • galactosyl sequoyitol
    • O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-05_006220&oldid=9529"