Difference between revisions of "Ec-07 006010"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] == * smiles: ** CC(C(C(=O)[O-])=CC(=O)[O-])C * inchi key: ** InChIKey=NJMGRJ...")
(Created page with "Category:Gene == Gene Ec-07_006010 == * left end position: ** 5907326 * transcription direction: ** NEGATIVE * right end position: ** 5917868 * centisome position: ** 76.4...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] ==
+
== Gene Ec-07_006010 ==
−
* smiles:
+
* left end position:
−
** CC(C(C(=O)[O-])=CC(=O)[O-])C
+
** 5907326
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 2-isopropylmaleate
+
** 5917868
−
* molecular weight:
+
* centisome position:
−
** 156.138    
+
** 76.49569    
 
* Synonym(s):
 
* Synonym(s):
−
** β-isopropylmaleate
+
** Esi_0148_0058
−
** 2-isopropylmaleic acid
+
** Esi0148_0058
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.14.11.2-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[3-ISOPROPYLMALISOM-RXN]]
+
*** Assignment: automated-name-match
−
* [[RXN-8991]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5907326}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21954611 21954611]
+
{{#set: transcription direction=NEGATIVE}}
−
* HMDB : HMDB12241
+
{{#set: right end position=5917868}}
−
* LIGAND-CPD:
+
{{#set: centisome position=76.49569   }}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02631 C02631]
+
{{#set: common name=Esi_0148_0058|Esi0148_0058}}
−
* CHEMSPIDER:
+
{{#set: reaction associated=1.14.11.2-RXN}}
−
** [http://www.chemspider.com/Chemical-Structure.10710392.html 10710392]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58085 58085]
+
−
* BIGG : 40241
+
−
{{#set: smiles=CC(C(C(=O)[O-])=CC(=O)[O-])C}}
+
−
{{#set: inchi key=InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L}}
+
−
{{#set: common name=2-isopropylmaleate}}
+
−
{{#set: molecular weight=156.138   }}
+
−
{{#set: common name=β-isopropylmaleate|2-isopropylmaleic acid}}
+
−
{{#set: reversible reaction associated=3-ISOPROPYLMALISOM-RXN|RXN-8991}}
+

Latest revision as of 20:52, 21 March 2018

Gene Ec-07_006010

  • left end position:
    • 5907326
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5917868
  • centisome position:
    • 76.49569
  • Synonym(s):
    • Esi_0148_0058
    • Esi0148_0058

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-07_006010&oldid=29877"