Difference between revisions of "Ec-08 002400"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3))) * in...")
 
(Created page with "Category:Gene == Gene Ec-08_002400 == * left end position: ** 2262946 * transcription direction: ** NEGATIVE * right end position: ** 2268070 * centisome position: ** 33.7...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] ==
+
== Gene Ec-08_002400 ==
* smiles:
+
* left end position:
** C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3)))
+
** 2262946
* inchi key:
+
* transcription direction:
** InChIKey=REFJWTPEDVJJIY-UHFFFAOYSA-M
+
** NEGATIVE
* common name:
+
* right end position:
** quercetin
+
** 2268070
* molecular weight:
+
* centisome position:
** 301.232    
+
** 33.79011    
 
* Synonym(s):
 
* Synonym(s):
** 3,5,7,3',4'-pentahydroxyflavone
+
** Esi_0007_0171
** 3,5,7,3',4'-pentahydroflavone
+
** Esi0007_0171
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN1F-462]]
+
* Reaction: [[PHOSGLYPHOS-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
* [[RXN-527]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-1042]]
 +
* [[PWY-7003]]
 +
* [[GLUCONEO-PWY]]
 +
* [[SUCSYN-PWY]]
 +
* [[PWY-6901]]
 +
* [[P124-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[PWY-6886]]
 +
* [[CALVIN-PWY]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[PWY-5484]]
 +
* [[P185-PWY]]
 +
* [[P122-PWY]]
 +
* [[PWY66-399]]
 
== External links  ==
 
== External links  ==
* NCI:
+
{{#set: left end position=2262946}}
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=9219 9219]
+
{{#set: transcription direction=NEGATIVE}}
* CAS : 117-39-5
+
{{#set: right end position=2268070}}
* Wikipedia : Quercetin
+
{{#set: centisome position=33.79011   }}
* PUBCHEM:
+
{{#set: common name=Esi_0007_0171|Esi0007_0171}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906036 46906036]
+
{{#set: reaction associated=PHOSGLYPHOS-RXN}}
* HMDB : HMDB05794
+
{{#set: pathway associated=PWY-1042|PWY-7003|GLUCONEO-PWY|SUCSYN-PWY|PWY-6901|P124-PWY|GLYCOLYSIS|PWY-6886|CALVIN-PWY|ANAGLYCOLYSIS-PWY|PWY-5484|P185-PWY|P122-PWY|PWY66-399}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00389 C00389]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57694 57694]
+
{{#set: smiles=C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3)))}}
+
{{#set: inchi key=InChIKey=REFJWTPEDVJJIY-UHFFFAOYSA-M}}
+
{{#set: common name=quercetin}}
+
{{#set: molecular weight=301.232   }}
+
{{#set: common name=3,5,7,3',4'-pentahydroxyflavone|3,5,7,3',4'-pentahydroflavone}}
+
{{#set: consumed by=RXN1F-462}}
+
{{#set: produced by=RXN-527}}
+

Latest revision as of 20:58, 21 March 2018

Gene Ec-08_002400

  • left end position:
    • 2262946
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2268070
  • centisome position:
    • 33.79011
  • Synonym(s):
    • Esi_0007_0171
    • Esi0007_0171

Reactions associated

Pathways associated

External links