Difference between revisions of "Ec-08 004280"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4 CPD-4] == * smiles: ** C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(...")
(Created page with "Category:Gene == Gene Ec-08_004280 == * left end position: ** 3999069 * transcription direction: ** NEGATIVE * right end position: ** 4008006 * centisome position: ** 59.7...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4 CPD-4] ==
+
== Gene Ec-08_004280 ==
−
* smiles:
+
* left end position:
−
** C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(N)=N3)))
+
** 3999069
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HPEUEJRPDGMIMY-IFQPEPLCSA-K
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** molybdopterin
+
** 4008006
−
* molecular weight:
+
* centisome position:
−
** 392.321    
+
** 59.713745    
 
* Synonym(s):
 
* Synonym(s):
−
** MPT
+
** Esi_0078_0067
−
** pyranopterin-dithiolate
+
** Esi0078_0067
−
** ene-dithiol pyranopterin
+
−
** H2Dtpp-mP
+
−
** [(5aR,8R,9aR)-2-amino-4-oxo-6,7-disulfanyl-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogen phosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-8344]]
+
* Reaction: [[2.4.1.221-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-8342]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3999069}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266731 45266731]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=4008006}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58698 58698]
+
{{#set: centisome position=59.713745   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0078_0067|Esi0078_0067}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05924 C05924]
+
{{#set: reaction associated=2.4.1.221-RXN}}
−
* HMDB : HMDB02206
+
−
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(N)=N3)))}}
+
−
{{#set: inchi key=InChIKey=HPEUEJRPDGMIMY-IFQPEPLCSA-K}}
+
−
{{#set: common name=molybdopterin}}
+
−
{{#set: molecular weight=392.321   }}
+
−
{{#set: common name=MPT|pyranopterin-dithiolate|ene-dithiol pyranopterin|H2Dtpp-mP|[(5aR,8R,9aR)-2-amino-4-oxo-6,7-disulfanyl-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogen phosphate}}
+
−
{{#set: consumed by=RXN-8344}}
+
−
{{#set: produced by=RXN-8342}}
+

Latest revision as of 20:27, 21 March 2018

Gene Ec-08_004280

  • left end position:
    • 3999069
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4008006
  • centisome position:
    • 59.713745
  • Synonym(s):
    • Esi_0078_0067
    • Esi0078_0067

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-08_004280&oldid=27076"