Difference between revisions of "Ec-09 002660"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11528 CPD-11528] == * smiles: ** CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
(Created page with "Category:Gene == Gene Ec-09_002660 == * Synonym(s): ** Esi_0171_0028 ** Esi0171_0028 == Reactions associated == * Reaction: RXN-14177 ** Source: orthology-aragem...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11528 CPD-11528] ==
+
== Gene Ec-09_002660 ==
* smiles:
+
** CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
+
* inchi key:
+
** InChIKey=QGJLCXXJEFRWHP-BUMUVWNNSA-J
+
* common name:
+
** OPC4-3-ketoacyl-CoA
+
* molecular weight:
+
** 997.797   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0171_0028
 +
** Esi0171_0028
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-14177]]
* [[RXN-10703]]
+
** Source: [[orthology-aragem]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0171_0028|Esi0171_0028}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237346 44237346]
+
{{#set: reaction associated=RXN-14177}}
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
+
{{#set: inchi key=InChIKey=QGJLCXXJEFRWHP-BUMUVWNNSA-J}}
+
{{#set: common name=OPC4-3-ketoacyl-CoA}}
+
{{#set: molecular weight=997.797    }}
+
{{#set: produced by=RXN-10703}}
+

Latest revision as of 20:52, 21 March 2018

Gene Ec-09_002660

  • Synonym(s):
    • Esi_0171_0028
    • Esi0171_0028

Reactions associated

Pathways associated

External links