Difference between revisions of "Ec-10 001890"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] == * smiles: ** CS(=O)CCC([N+])C(=O)[O-] * inchi key: ** InChIKey=QEFRNWWLZK...")
(Created page with "Category:Gene == Gene Ec-10_001890 == * left end position: ** 1880080 * transcription direction: ** POSITIVE * right end position: ** 1888824 * centisome position: ** 28.9...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] ==
+
== Gene Ec-10_001890 ==
−
* smiles:
+
* left end position:
−
** CS(=O)CCC([N+])C(=O)[O-]
+
** 1880080
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** L-methionine-(R)-S-oxide
+
** 1888824
−
* molecular weight:
+
* centisome position:
−
** 165.207    
+
** 28.919926    
 
* Synonym(s):
 
* Synonym(s):
−
** L-methionine-R-sulfoxide
+
** Esi_0168_0037
 +
** Esi0168_0037
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.8.4.14-RXN]]
+
* Reaction: [[1.5.1.19-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1880080}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11862103 11862103]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=1888824}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58773 58773]
+
{{#set: centisome position=28.919926   }}
−
* BIGG : 2217370
+
{{#set: common name=Esi_0168_0037|Esi0168_0037}}
−
{{#set: smiles=CS(=O)CCC([N+])C(=O)[O-]}}
+
{{#set: reaction associated=1.5.1.19-RXN}}
−
{{#set: inchi key=InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N}}
+
−
{{#set: common name=L-methionine-(R)-S-oxide}}
+
−
{{#set: molecular weight=165.207   }}
+
−
{{#set: common name=L-methionine-R-sulfoxide}}
+
−
{{#set: consumed by=1.8.4.14-RXN}}
+

Latest revision as of 20:48, 21 March 2018

Gene Ec-10_001890

  • left end position:
    • 1880080
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1888824
  • centisome position:
    • 28.919926
  • Synonym(s):
    • Esi_0168_0037
    • Esi0168_0037

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-10_001890&oldid=29414"