Difference between revisions of "Ec-10 006110"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Ec-10_006110 == * left end position: ** 6197821 * transcription direction: ** POSITIVE * right end position: ** 6217558 * centisome position: ** 95.3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-10_006110 == |
− | * | + | * left end position: |
− | ** | + | ** 6197821 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 6217558 |
− | * | + | * centisome position: |
− | ** | + | ** 95.33665 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0006_0183 |
− | ** | + | ** Esi0006_0183 |
+ | ** CPS | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[CARBPSYN-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | * Reaction: [[GLUTAMIN-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN-13202]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN-14196]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN-16909]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN-16910]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
+ | * [[PWY-4984]] | ||
+ | * [[GLUTAMINDEG-PWY]] | ||
+ | * [[ARGSYN-PWY]] | ||
+ | * [[PWY-5154]] | ||
+ | * [[ARGSYNBSUB-PWY]] | ||
+ | * [[PWY-7693]] | ||
+ | * [[PWY-7400]] | ||
+ | * [[PWY-5686]] | ||
+ | * [[CITRULBIO-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=6197821}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=6217558}} | |
− | {{#set: | + | {{#set: centisome position=95.33665 }} |
− | {{#set: | + | {{#set: common name=Esi_0006_0183|Esi0006_0183|CPS}} |
− | {{#set: | + | {{#set: reaction associated=CARBPSYN-RXN|GLUTAMIN-RXN|RXN-13202|RXN-14196|RXN-16909|RXN-16910}} |
− | {{#set: | + | {{#set: pathway associated=PWY-4984|GLUTAMINDEG-PWY|ARGSYN-PWY|PWY-5154|ARGSYNBSUB-PWY|PWY-7693|PWY-7400|PWY-5686|CITRULBIO-PWY}} |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:18, 21 March 2018
Gene Ec-10_006110
- left end position:
- 6197821
- transcription direction:
- POSITIVE
- right end position:
- 6217558
- centisome position:
- 95.33665
- Synonym(s):
- Esi_0006_0183
- Esi0006_0183
- CPS
Reactions associated
- Reaction: CARBPSYN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: GLUTAMIN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-13202
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14196
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16909
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16910
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
Pathways associated
- PWY-4984
- GLUTAMINDEG-PWY
- ARGSYN-PWY
- PWY-5154
- ARGSYNBSUB-PWY
- PWY-7693
- PWY-7400
- PWY-5686
- CITRULBIO-PWY