Difference between revisions of "Ec-12 000650"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-564 CPD-564] == * smiles: ** C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1) * inchi key: ** InChI...")
(Created page with "Category:Gene == Gene Ec-12_000650 == * left end position: ** 678882 * transcription direction: ** POSITIVE * right end position: ** 687135 * centisome position: ** 8.1439...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-564 CPD-564] ==
+
== Gene Ec-12_000650 ==
−
* smiles:
+
* left end position:
−
** C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1)
+
** 678882
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IQFWYNFDWRYSRA-OEQWSMLSSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** S-ribosyl-L-homocysteine
+
** 687135
−
* molecular weight:
+
* centisome position:
−
** 267.296    
+
** 8.143928    
 
* Synonym(s):
 
* Synonym(s):
−
** S-Ribosylhomocysteine
+
** Esi_0069_0107
−
** Ribose-5-S-homocysteine
+
** Esi0069_0107
−
** S-D-ribosyl-L-homocysteine
+
** KAS
−
** ribose-5-S-homocysteine
+
−
** S-ribosylhomocysteine
+
−
** S-(5-deoxy-D-ribos-5-yl)-L-homocysteine
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.3.1.41-RXN]]
−
* [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
* Reaction: [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
** Source: [[orthology-aragem]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[3-OXOACYL-ACP-SYNTH-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[ACP-S-ACETYLTRANSFER-RXN]]
 +
** Source: [[orthology-aragem]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-10059]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-10654]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-10658]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-11474]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-11479]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-16615]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-16621]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-16625]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-16629]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-9516]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
** Source: [[orthology-aragem]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-9523]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
** Source: [[orthology-aragem]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-9527]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
** Source: [[orthology-aragem]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-9531]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
** Source: [[orthology-aragem]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-9535]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
** Source: [[orthology-aragem]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-9539]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
** Source: [[orthology-aragem]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-9632]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-9648]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-9650]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-9651]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-9652]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-9653]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-9654]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN0-2141]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN1G-368]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN1G-445]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN1G-460]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN1G-499]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN3O-1803]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-6113]]
 +
* [[FASYN-ELONG-PWY]]
 +
* [[PWY-6519]]
 +
* [[PWY-7388]]
 +
* [[PWY-5994]]
 +
* [[PWY-5971]]
 +
* [[PWY-6282]]
 +
* [[PWY-5965]]
 +
* [[PWY-5989]]
 +
* [[PWY-5966]]
 +
* [[PWYG-321]]
 +
* [[FASYN-INITIAL-PWY]]
 +
* [[PWY-7663]]
 +
* [[PWY-7664]]
 +
* [[PWY3O-355]]
 +
* [[PWY0-862]]
 
== External links  ==
 
== External links  ==
−
* CAS : 37558-16-0
+
{{#set: left end position=678882}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245776 25245776]
+
{{#set: right end position=687135}}
−
* CHEBI:
+
{{#set: centisome position=8.143928   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17575 17575]
+
{{#set: common name=Esi_0069_0107|Esi0069_0107|KAS}}
−
* BIGG : 42044
+
{{#set: reaction associated=2.3.1.41-RXN|3-OXOACYL-ACP-SYNTH-BASE-RXN|3-OXOACYL-ACP-SYNTH-RXN|ACP-S-ACETYLTRANSFER-RXN|RXN-10059|RXN-10654|RXN-10658|RXN-11474|RXN-11479|RXN-16615|RXN-16621|RXN-16625|RXN-16629|RXN-9516|RXN-9523|RXN-9527|RXN-9531|RXN-9535|RXN-9539|RXN-9632|RXN-9648|RXN-9650|RXN-9651|RXN-9652|RXN-9653|RXN-9654|RXN0-2141|RXN1G-368|RXN1G-445|RXN1G-460|RXN1G-499|RXN3O-1803}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-6113|FASYN-ELONG-PWY|PWY-6519|PWY-7388|PWY-5994|PWY-5971|PWY-6282|PWY-5965|PWY-5989|PWY-5966|PWYG-321|FASYN-INITIAL-PWY|PWY-7663|PWY-7664|PWY3O-355|PWY0-862}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03539 C03539]
+
−
{{#set: smiles=C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=IQFWYNFDWRYSRA-OEQWSMLSSA-N}}
+
−
{{#set: common name=S-ribosyl-L-homocysteine}}
+
−
{{#set: molecular weight=267.296   }}
+
−
{{#set: common name=S-Ribosylhomocysteine|Ribose-5-S-homocysteine|S-D-ribosyl-L-homocysteine|ribose-5-S-homocysteine|S-ribosylhomocysteine|S-(5-deoxy-D-ribos-5-yl)-L-homocysteine}}
+
−
{{#set: produced by=ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN}}
+

Latest revision as of 20:35, 21 March 2018

Gene Ec-12_000650

  • left end position:
    • 678882
  • transcription direction:
    • POSITIVE
  • right end position:
    • 687135
  • centisome position:
    • 8.143928
  • Synonym(s):
    • Esi_0069_0107
    • Esi0069_0107
    • KAS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-12_000650&oldid=27939"