Difference between revisions of "Ec-12 004670"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6364 PWY-6364] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == * smiles: ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) * inchi key...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6364 PWY-6364] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))
 +
* inchi key:
 +
** InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N
 
* common name:
 
* common name:
−
** D-myo-inositol (1,3,4)-trisphosphate biosynthesis
+
** D-galactosylononitol
 +
* molecular weight:
 +
** 356.326   
 
* Synonym(s):
 
* Synonym(s):
 +
** galactosyl sequoyitol
 +
** O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''3''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[2.7.1.127-RXN]]
+
* [[RXN-8281]]
−
** 1 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Ec-16_003350]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=3.1.3.62-RXN 3.1.3.62-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8730 RXN-8730]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2759}}
+
* PUBCHEM:
−
{{#set: common name=D-myo-inositol (1,3,4)-trisphosphate biosynthesis}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202605 25202605]
−
{{#set: reaction found=1}}
+
{{#set: smiles=COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))}}
−
{{#set: total reaction=3}}
+
{{#set: inchi key=InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N}}
−
{{#set: completion rate=33.0}}
+
{{#set: common name=D-galactosylononitol}}
 +
{{#set: molecular weight=356.326    }}
 +
{{#set: common name=galactosyl sequoyitol|O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol}}
 +
{{#set: produced by=RXN-8281}}

Revision as of 14:16, 21 March 2018

Metabolite CPD-8058

  • smiles:
    • COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))
  • inchi key:
    • InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N
  • common name:
    • D-galactosylononitol
  • molecular weight:
    • 356.326
  • Synonym(s):
    • galactosyl sequoyitol
    • O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-12_004670&oldid=17093"