Difference between revisions of "Ec-12 007710"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17624 CPD-17624] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-]...")
(Created page with "Category:Gene == Gene Ec-12_007710 == * left end position: ** 6843515 * transcription direction: ** NEGATIVE * right end position: ** 6847424 * centisome position: ** 82.0...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17624 CPD-17624] ==
+
== Gene Ec-12_007710 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 6843515
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IISWKVFHQLAOMW-BTFUZUOASA-I
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** ω-carboxy-(9Z)-octadec-9-enoyl-CoA
+
** 6847424
−
* molecular weight:
+
* centisome position:
−
** 1056.928    
+
** 82.0954    
 
* Synonym(s):
 
* Synonym(s):
−
** 18-carboxyl oleoyl-CoA
+
** Esi_0159_0022
 +
** Esi0159_0022
 +
** ALG3
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-5466]]
−
* [[RXN-16418]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-5467]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-5468]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-5469]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=6843515}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820430 91820430]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=6847424}}
−
{{#set: inchi key=InChIKey=IISWKVFHQLAOMW-BTFUZUOASA-I}}
+
{{#set: centisome position=82.0954   }}
−
{{#set: common name=ω-carboxy-(9Z)-octadec-9-enoyl-CoA}}
+
{{#set: common name=Esi_0159_0022|Esi0159_0022|ALG3}}
−
{{#set: molecular weight=1056.928   }}
+
{{#set: reaction associated=RXN-5466|RXN-5467|RXN-5468|RXN-5469}}
−
{{#set: common name=18-carboxyl oleoyl-CoA}}
+
{{#set: pathway associated=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS}}
−
{{#set: produced by=RXN-16418}}
+

Latest revision as of 20:54, 21 March 2018

Gene Ec-12_007710

  • left end position:
    • 6843515
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 6847424
  • centisome position:
    • 82.0954
  • Synonym(s):
    • Esi_0159_0022
    • Esi0159_0022
    • ALG3

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-12_007710&oldid=30152"