Difference between revisions of "Ec-16 000550"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] == * smiles: ** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2)) * inchi key: ** InCh...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13334 RXN-13334] == * direction: ** LEFT-TO-RIGHT * common name: ** phosphatidylinositol phosph...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13334 RXN-13334] ==
−
* smiles:
+
* direction:
−
** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M
+
 
* common name:
 
* common name:
−
** leucodopachrome
+
** phosphatidylinositol phospholipase C
−
* molecular weight:
+
* ec number:
−
** 194.166   
+
** [http://enzyme.expasy.org/EC/3.1.4.11 EC-3.1.4.11]
 
* Synonym(s):
 
* Synonym(s):
−
** cyclo-dopa
 
−
** 2-carboxy-2,3-dihydro-5,6-dihydroxyindole
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11369]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-1108]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[DIACYLGLYCEROL]][c] '''+''' 1 [[INOSITOL-1-4-BISPHOSPHATE]][c]
−
* [[RXN-8483]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 a 1-phosphatidyl-1D-myo-inositol 4-phosphate[c] '''+''' 1 H2O[c] '''=>''' 1 H+[c] '''+''' 1 a 1,2-diacyl-sn-glycerol[c] '''+''' 1 D-myo-inositol (1,4)-bisphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-27_005750]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202233 25202233]
+
{{#set: common name=phosphatidylinositol phospholipase C}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-3.1.4.11}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05604 C05604]
+
{{#set: gene associated=Ec-27_005750}}
−
* HMDB : HMDB04067
+
{{#set: in pathway=}}
−
{{#set: smiles=C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: inchi key=InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=leucodopachrome}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=194.166    }}
+
−
{{#set: common name=cyclo-dopa|2-carboxy-2,3-dihydro-5,6-dihydroxyindole}}
+
−
{{#set: consumed by=RXN-11369}}
+
−
{{#set: produced by=RXN-8483}}
+

Revision as of 14:31, 21 March 2018

Reaction RXN-13334

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • phosphatidylinositol phospholipase C
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-16_000550&oldid=19341"