Difference between revisions of "Ec-18 002280"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ASPARTATEKIN-RXN ASPARTATEKIN-RXN] == * direction: ** REVERSIBLE * common name: ** aspartate/glutam...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] == * smiles: ** C(O)C(O)C([N+])C(=O)[O-] * inchi key: ** InChIKey=JBNUARFQ...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ASPARTATEKIN-RXN ASPARTATEKIN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** C(O)C(O)C([N+])C(=O)[O-]
 +
* inchi key:
 +
** InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N
 
* common name:
 
* common name:
** aspartate/glutamate/uridylate kinase
+
** 4-hydroxy-L-threonine
** aspartate kinase/homoserine dehydrogenase
+
* molecular weight:
** Aspartate/glutamate/uridylate kinase
+
** 135.119   
** aspartate kinase
+
* ec number:
+
** [http://enzyme.expasy.org/EC/2.7.2.4 EC-2.7.2.4]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** (2S,3S)-2-amino-3,4-dihydroxybutanoic acid
 +
** hydroxythreonine
 +
** 3-hydroxyhomoserine
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[L-ASPARTATE]][c] '''+''' 1 [[ATP]][c] '''<=>''' 1 [[L-BETA-ASPARTYL-P]][c] '''+''' 1 [[ADP]][c]
+
* [[RXN-14125]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 L-aspartate[c] '''+''' 1 ATP[c] '''<=>''' 1 L-aspartyl-4-phosphate[c] '''+''' 1 ADP[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-11_000830]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
** [[pantograph]]-[[aragem]]
+
* [[Ec-13_002530]]
+
** ESILICULOSUS_GENOME
+
***EC-NUMBER
+
* [[Ec-27_003730]]
+
** ESILICULOSUS_GENOME
+
***AUTOMATED-NAME-MATCH
+
* [[Ec-24_000610]]
+
** ESILICULOSUS_GENOME
+
***AUTOMATED-NAME-MATCH
+
== Pathways  ==
+
* [[HOMOSERSYN-PWY]], L-homoserine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=HOMOSERSYN-PWY HOMOSERSYN-PWY]
+
** '''3''' reactions found over '''3''' reactions in the full pathway
+
* [[PWY-7153]], grixazone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7153 PWY-7153]
+
** '''2''' reactions found over '''8''' reactions in the full pathway
+
* [[DAPLYSINESYN-PWY]], L-lysine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=DAPLYSINESYN-PWY DAPLYSINESYN-PWY]
+
** '''6''' reactions found over '''9''' reactions in the full pathway
+
* [[PWY-2942]], L-lysine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2942 PWY-2942]
+
** '''6''' reactions found over '''7''' reactions in the full pathway
+
* [[PWY-2941]], L-lysine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2941 PWY-2941]
+
** '''6''' reactions found over '''9''' reactions in the full pathway
+
* [[PWY-6559]], spermidine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6559 PWY-6559]
+
** '''2''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY-6562]], norspermidine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6562 PWY-6562]
+
** '''2''' reactions found over '''6''' reactions in the full pathway
+
* [[PWY-5097]], L-lysine biosynthesis VI: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5097 PWY-5097]
+
** '''7''' reactions found over '''7''' reactions in the full pathway
+
* [[P101-PWY]], ectoine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=P101-PWY P101-PWY]
+
** '''2''' reactions found over '''5''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-aragem]]
+
*** Tool: [[pantograph]]
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* CAS : 21768-45-6
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23776 23776]
+
* PUBCHEM:
* LIGAND-RXN:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852420 49852420]
** [http://www.genome.jp/dbget-bin/www_bget?R00480 R00480]
+
* LIGAND-CPD:
* UNIPROT:
+
** [http://www.genome.jp/dbget-bin/www_bget?C06056 C06056]
** [http://www.uniprot.org/uniprot/P08495 P08495]
+
* CHEMSPIDER:
** [http://www.uniprot.org/uniprot/P44505 P44505]
+
** [http://www.chemspider.com/Chemical-Structure.167988.html 167988]
** [http://www.uniprot.org/uniprot/P27725 P27725]
+
* CHEBI:
** [http://www.uniprot.org/uniprot/Q04795 Q04795]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60904 60904]
** [http://www.uniprot.org/uniprot/Q57991 Q57991]
+
* BIGG : 1450010
** [http://www.uniprot.org/uniprot/P00561 P00561]
+
{{#set: smiles=C(O)C(O)C([N+])C(=O)[O-]}}
** [http://www.uniprot.org/uniprot/P00562 P00562]
+
{{#set: inchi key=InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N}}
** [http://www.uniprot.org/uniprot/Q9PHT4 Q9PHT4]
+
{{#set: common name=4-hydroxy-L-threonine}}
** [http://www.uniprot.org/uniprot/Q9JTN3 Q9JTN3]
+
{{#set: molecular weight=135.119    }}
** [http://www.uniprot.org/uniprot/P53553 P53553]
+
{{#set: common name=(2S,3S)-2-amino-3,4-dihydroxybutanoic acid|hydroxythreonine|3-hydroxyhomoserine}}
** [http://www.uniprot.org/uniprot/P10869 P10869]
+
{{#set: produced by=RXN-14125}}
** [http://www.uniprot.org/uniprot/P08660 P08660]
+
** [http://www.uniprot.org/uniprot/P26512 P26512]
+
** [http://www.uniprot.org/uniprot/P37142 P37142]
+
** [http://www.uniprot.org/uniprot/P41403 P41403]
+
** [http://www.uniprot.org/uniprot/P0A4Z9 P0A4Z9]
+
** [http://www.uniprot.org/uniprot/Q9SA18 Q9SA18]
+
** [http://www.uniprot.org/uniprot/P49079 P49079]
+
** [http://www.uniprot.org/uniprot/P49080 P49080]
+
** [http://www.uniprot.org/uniprot/P93402 P93402]
+
** [http://www.uniprot.org/uniprot/O81852 O81852]
+
** [http://www.uniprot.org/uniprot/O63067 O63067]
+
** [http://www.uniprot.org/uniprot/O65027 O65027]
+
{{#set: direction=REVERSIBLE}}
+
{{#set: common name=aspartate/glutamate/uridylate kinase}}
+
{{#set: common name=aspartate kinase/homoserine dehydrogenase}}
+
{{#set: common name=Aspartate/glutamate/uridylate kinase}}
+
{{#set: common name=aspartate kinase}}
+
{{#set: ec number=EC-2.7.2.4}}
+
{{#set: gene associated=Ec-11_000830|Ec-13_002530|Ec-27_003730|Ec-24_000610}}
+
{{#set: in pathway=HOMOSERSYN-PWY|PWY-7153|DAPLYSINESYN-PWY|PWY-2942|PWY-2941|PWY-6559|PWY-6562|PWY-5097|P101-PWY}}
+
{{#set: reconstruction category=orthology|annotation}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Revision as of 14:30, 21 March 2018

Metabolite CPD0-2189

  • smiles:
    • C(O)C(O)C([N+])C(=O)[O-]
  • inchi key:
    • InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N
  • common name:
    • 4-hydroxy-L-threonine
  • molecular weight:
    • 135.119
  • Synonym(s):
    • (2S,3S)-2-amino-3,4-dihydroxybutanoic acid
    • hydroxythreonine
    • 3-hydroxyhomoserine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(O)C([N+])C(=O)[O-" cannot be used as a page name in this wiki.