Difference between revisions of "Ec-19 000810"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-653 CPD-653] == * smiles: ** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2...")
(Created page with "Category:Gene == Gene Ec-19_000810 == * Synonym(s): ** Esi_0054_0026 ** Esi0054_0026 == Reactions associated == * Reaction: ATPASE-RXN ** Source: orthology-aragem...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-653 CPD-653] ==
+
== Gene Ec-19_000810 ==
−
* smiles:
+
−
** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)
+
−
* inchi key:
+
−
** InChIKey=IDBZKGQRLBFUFQ-VPHRTNKSSA-L
+
−
* common name:
+
−
** (S)-NADHX
+
−
* molecular weight:
+
−
** 681.445   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (6S)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide
+
** Esi_0054_0026
 +
** Esi0054_0026
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
−
* [[RXN-12753]]
+
** Source: [[orthology-aragem]]
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=Esi_0054_0026|Esi0054_0026}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203523 25203523]
+
{{#set: reaction associated=ATPASE-RXN}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64074 64074]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C04856 C04856]
+
−
* HMDB : HMDB59644
+
−
{{#set: smiles=C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)}}
+
−
{{#set: inchi key=InChIKey=IDBZKGQRLBFUFQ-VPHRTNKSSA-L}}
+
−
{{#set: common name=(S)-NADHX}}
+
−
{{#set: molecular weight=681.445    }}
+
−
{{#set: common name=(6S)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide}}
+
−
{{#set: produced by=RXN-12753}}
+

Latest revision as of 20:54, 21 March 2018

Gene Ec-19_000810

  • Synonym(s):
    • Esi_0054_0026
    • Esi0054_0026

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-19_000810&oldid=30196"