Difference between revisions of "Ec-20 004590"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE-5P PYRIDOXAMINE-5P] == * smiles: ** CC1(C(=C(C(COP([O-])([O-])=O)=CN=1)C[N+])O) *...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5886 PWY-5886] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE-5P PYRIDOXAMINE-5P] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5886 PWY-5886] ==
−
* smiles:
+
* taxonomic range:
−
** CC1(C(=C(C(COP([O-])([O-])=O)=CN=1)C[N+])O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
** InChIKey=ZMJGSOSNSPKHNH-UHFFFAOYSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** pyridoxamine 5'-phosphate
+
** 4-hydroxyphenylpyruvate biosynthesis
−
* molecular weight:
+
−
** 247.167   
+
 
* Synonym(s):
 
* Synonym(s):
−
** pyridoxamine phosphate
 
−
** PMP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[PMPOXI-RXN]]
+
'''1''' reactions found over '''1''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
−
* [[PYRAMKIN-RXN]]
+
** 0 associated gene:
−
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 529-96-4
+
{{#set: taxonomic range=TAX-2157}}
−
* BIGG : 35609
+
{{#set: taxonomic range=TAX-2759}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246271 25246271]
+
{{#set: common name=4-hydroxyphenylpyruvate biosynthesis}}
−
* HMDB : HMDB01555
+
{{#set: reaction found=1}}
−
* LIGAND-CPD:
+
{{#set: total reaction=1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00647 C00647]
+
{{#set: completion rate=100.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58451 58451]
+
−
* METABOLIGHTS : MTBLC58451
+
−
{{#set: smiles=CC1(C(=C(C(COP([O-])([O-])=O)=CN=1)C[N+])O)}}
+
−
{{#set: inchi key=InChIKey=ZMJGSOSNSPKHNH-UHFFFAOYSA-M}}
+
−
{{#set: common name=pyridoxamine 5'-phosphate}}
+
−
{{#set: molecular weight=247.167    }}
+
−
{{#set: common name=pyridoxamine phosphate|PMP}}
+
−
{{#set: consumed by=PMPOXI-RXN}}
+
−
{{#set: produced by=PYRAMKIN-RXN}}
+

Revision as of 22:26, 17 March 2018

Pathway PWY-5886

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-20_004590&oldid=12966"