Difference between revisions of "Ec-22 000060"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] == * smiles: ** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N...")
 
(Created page with "Category:Gene == Gene Ec-26_001660 == * left end position: ** 2064380 * transcription direction: ** POSITIVE * right end position: ** 2090906 * centisome position: ** 31.3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] ==
+
== Gene Ec-26_001660 ==
−
* smiles:
+
* left end position:
−
** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O
+
** 2064380
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** L-threonylcarbamoyladenylate
+
** 2090906
−
* molecular weight:
+
* centisome position:
−
** 490.322    
+
** 31.357601    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0077_0055
 +
** Esi0077_0055
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14570]]
+
* [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
−
* [[RXN-14569]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2064380}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464565 71464565]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2090906}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73682 73682]
+
{{#set: centisome position=31.357601   }}
−
{{#set: smiles=CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O}}
+
{{#set: common name=Esi_0077_0055|Esi0077_0055}}
−
{{#set: inchi key=InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L}}
+
{{#set: reaction associated=ATPASE-RXN}}
−
{{#set: common name=L-threonylcarbamoyladenylate}}
+
−
{{#set: molecular weight=490.322   }}
+
−
{{#set: consumed by=RXN-14570}}
+
−
{{#set: consumed or produced by=RXN-14569}}
+

Revision as of 22:39, 17 March 2018

Gene Ec-26_001660

  • left end position:
    • 2064380
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2090906
  • centisome position:
    • 31.357601
  • Synonym(s):
    • Esi_0077_0055
    • Esi0077_0055

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-22_000060&oldid=13933"