Difference between revisions of "Ec-23 003630"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONATE L-GULONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=R...") |
(Created page with "Category:Gene == Gene Ec-23_003630 == * left end position: ** 3938742 * transcription direction: ** POSITIVE * right end position: ** 3946404 * centisome position: ** 81.3...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-23_003630 == |
− | * | + | * left end position: |
− | ** | + | ** 3938742 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3946404 |
− | * | + | * centisome position: |
− | ** | + | ** 81.38793 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0118_0024 |
+ | ** Esi0118_0024 | ||
+ | ** HPPD | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]] | |
− | * [[RXN- | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[GLYOXIII-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-10815]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7432]] | ||
+ | * [[PWY-1581]] | ||
+ | * [[TYRFUMCAT-PWY]] | ||
+ | * [[PWY-1422]] | ||
+ | * [[PWY-6318]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3938742}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3946404}} | |
− | + | {{#set: centisome position=81.38793 }} | |
− | + | {{#set: common name=Esi_0118_0024|Esi0118_0024|HPPD}} | |
− | + | {{#set: reaction associated=4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN|GLYOXIII-RXN|RXN-10815}} | |
− | + | {{#set: pathway associated=PWY-7432|PWY-1581|TYRFUMCAT-PWY|PWY-1422|PWY-6318}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:01, 21 March 2018
Gene Ec-23_003630
- left end position:
- 3938742
- transcription direction:
- POSITIVE
- right end position:
- 3946404
- centisome position:
- 81.38793
- Synonym(s):
- Esi_0118_0024
- Esi0118_0024
- HPPD
Reactions associated
- Reaction: 4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Reaction: GLYOXIII-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-10815
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome