Difference between revisions of "HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3) * inchi ke...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N |
* common name: | * common name: | ||
− | ** | + | ** cholest-5-en-3-one |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 384.644 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12693]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9908107 9908107] |
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63906 63906] |
− | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC63906 |
− | {{#set: smiles= | + | {{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N}} |
− | {{#set: common name= | + | {{#set: common name=cholest-5-en-3-one}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=384.644 }} |
− | + | {{#set: produced by=RXN-12693}} | |
− | {{#set: produced by=RXN- | + |
Revision as of 21:56, 17 March 2018
Contents
Metabolite CPD-13684
- smiles:
- CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N
- common name:
- cholest-5-en-3-one
- molecular weight:
- 384.644
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.