Difference between revisions of "P241-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7524 CPD-7524] == * smiles: ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12399 RXN-12399] == * direction: ** LEFT-TO-RIGHT * common name: ** xyloglucan XLXG oligosaccha...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7524 CPD-7524] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12399 RXN-12399] ==
−
* smiles:
+
* direction:
−
** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N
+
 
* common name:
 
* common name:
−
** 7,9,9'-cis-neurosporene
+
** xyloglucan XLXG oligosaccharide β-galactosidase
−
* molecular weight:
+
** Glycoside hydrolase-type carbohydrate-binding, subgroup
−
** 538.898   
+
** Beta-galactosidase, family GH2
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.2.1.23 EC-3.2.1.23]
 
* Synonym(s):
 
* Synonym(s):
−
** proneurosporene
 
−
** 7,9,9'-tri-cis-neurosporene
 
−
** 7,9,9'-tricis-neurosporene
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11357]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-13377]][c] '''=>''' 1 [[CPD-13375]][c] '''+''' 1 [[D-galactopyranose]][c]
−
* [[RXN-11356]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H2O[c] '''+''' 1 XLXG xyloglucan oligosaccharide[c] '''=>''' 1 XXXG xyloglucan oligosaccharide[c] '''+''' 1 D-galactopyranose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-12_007000]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-06_001410]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6807]], xyloglucan degradation II (exoglucanase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6807 PWY-6807]
 +
** '''3''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C19759 C19759]
+
{{#set: common name=xyloglucan XLXG oligosaccharide β-galactosidase}}
−
* CHEBI:
+
{{#set: common name=Glycoside hydrolase-type carbohydrate-binding, subgroup}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62463 62463]
+
{{#set: common name=Beta-galactosidase, family GH2}}
−
* PUBCHEM:
+
{{#set: ec number=EC-3.2.1.23}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244751 25244751]
+
{{#set: gene associated=Ec-12_007000|Ec-06_001410}}
−
{{#set: smiles=CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C}}
+
{{#set: in pathway=PWY-6807}}
−
{{#set: inchi key=InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=7,9,9'-cis-neurosporene}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: molecular weight=538.898    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=proneurosporene|7,9,9'-tri-cis-neurosporene|7,9,9'-tricis-neurosporene}}
+
−
{{#set: consumed by=RXN-11357}}
+
−
{{#set: produced by=RXN-11356}}
+

Revision as of 14:36, 21 March 2018

Reaction RXN-12399

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • xyloglucan XLXG oligosaccharide β-galactosidase
    • Glycoside hydrolase-type carbohydrate-binding, subgroup
    • Beta-galactosidase, family GH2
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 XLXG xyloglucan oligosaccharide[c] => 1 XXXG xyloglucan oligosaccharide[c] + 1 D-galactopyranose[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6807, xyloglucan degradation II (exoglucanase): PWY-6807
    • 3 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=P241-PWY&oldid=20009"