Difference between revisions of "PREPHENATE-DEHYDROGENASE-NADP+-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-22_000080 == * left end position: ** 101833 * transcription direction: ** NEGATIVE * right end position: ** 111058 * centisome position: ** 2.2550...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14675 CPD-14675] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-22_000080 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14675 CPD-14675] ==
* left end position:
+
* smiles:
** 101833
+
** CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J
* right end position:
+
* common name:
** 111058
+
** pristanoyl-CoA
* centisome position:
+
* molecular weight:
** 2.2550125    
+
** 1043.995    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0162_0001
+
** 2,6,10,14-tetramethylpentadecanoyl-CoA
** Esi0162_0001
+
** 2,6,10,14-tetramethylpentadecanoyl-coenzyme A
** TRE
+
** pristanoyl-coenzyme A
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[TREHALA-RXN]]
+
== Reaction(s) known to produce the compound ==
** esiliculosus_genome
+
* [[RXN66-484]]
***ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[PWY0-1182]]
+
* [[PWY0-1466]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=101833}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289196 86289196]
{{#set: right end position=111058}}
+
* CHEBI:
{{#set: centisome position=2.2550125   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77250 77250]
{{#set: common name=Esi_0162_0001|Esi0162_0001|TRE}}
+
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: reaction associated=TREHALA-RXN}}
+
{{#set: inchi key=InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J}}
{{#set: pathway associated=PWY0-1182|PWY0-1466}}
+
{{#set: common name=pristanoyl-CoA}}
 +
{{#set: molecular weight=1043.995   }}
 +
{{#set: common name=2,6,10,14-tetramethylpentadecanoyl-CoA|2,6,10,14-tetramethylpentadecanoyl-coenzyme A|pristanoyl-coenzyme A}}
 +
{{#set: produced by=RXN66-484}}

Revision as of 22:16, 17 March 2018

Metabolite CPD-14675

  • smiles:
    • CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J
  • common name:
    • pristanoyl-CoA
  • molecular weight:
    • 1043.995
  • Synonym(s):
    • 2,6,10,14-tetramethylpentadecanoyl-CoA
    • 2,6,10,14-tetramethylpentadecanoyl-coenzyme A
    • pristanoyl-coenzyme A

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.