Difference between revisions of "PWY-1121"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3) * inchi ke...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1121 PWY-1121] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58023 TAX-5...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1121 PWY-1121] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58023 TAX-58023] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** suberin monomers biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''6''' reactions found over '''19''' reactions in the full pathway |
− | == Reaction(s) | + | * [[6.2.1.34-RXN]] |
− | * [[RXN- | + | ** 2 associated gene(s): |
− | == | + | *** [[Ec-10_001480]] |
+ | *** [[Ec-04_001280]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-28_003750]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[RXN-1104]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_004720]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-1126]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-10_001480]] | ||
+ | *** [[Ec-04_001280]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[RXN-16389]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-12_008720]] | ||
+ | *** [[Ec-01_001560]] | ||
+ | *** [[Ec-02_006430]] | ||
+ | *** [[Ec-03_003710]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-16418]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-03_003710]] | ||
+ | *** [[Ec-01_001560]] | ||
+ | *** [[Ec-02_006430]] | ||
+ | *** [[Ec-12_008720]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PALMITOYL-COA-HYDROLASE-RXN PALMITOYL-COA-HYDROLASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PHENYLALANINE-AMMONIA-LYASE-RXN PHENYLALANINE-AMMONIA-LYASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-1103 RXN-1103] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12155 RXN-12155] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12156 RXN-12156] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12157 RXN-12157] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16398 RXN-16398] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16400 RXN-16400] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16416 RXN-16416] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16417 RXN-16417] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9666 RXN-9666] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=TRANS-CINNAMATE-4-MONOOXYGENASE-RXN TRANS-CINNAMATE-4-MONOOXYGENASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=TYRAMINE-N-FERULOYLTRANSFERASE-RXN TYRAMINE-N-FERULOYLTRANSFERASE-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-1121 PWY-1121] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-58023}} |
− | + | {{#set: common name=suberin monomers biosynthesis}} | |
− | + | {{#set: reaction found=6}} | |
− | + | {{#set: total reaction=19}} | |
− | + | {{#set: completion rate=32.0}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:18, 21 March 2018
Pathway PWY-1121
- taxonomic range:
- common name:
- suberin monomers biosynthesis
- Synonym(s):
Reaction(s) found
6 reactions found over 19 reactions in the full pathway
- 6.2.1.34-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-1104
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-1126
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-16389
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-16418
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
- PALMITOYL-COA-HYDROLASE-RXN
- PHENYLALANINE-AMMONIA-LYASE-RXN
- RXN-1103
- RXN-12155
- RXN-12156
- RXN-12157
- RXN-16398
- RXN-16400
- RXN-16416
- RXN-16417
- RXN-9666
- TRANS-CINNAMATE-4-MONOOXYGENASE-RXN
- TYRAMINE-N-FERULOYLTRANSFERASE-RXN
External links
- ARACYC: