Difference between revisions of "PWY-2002"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == * smiles: ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O * inchi k...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Amino-Acids-20 Amino-Acids-20] == * common name: ** a standard α amino acid * Synonym(s):...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Amino-Acids-20 Amino-Acids-20] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a standard α amino acid |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a protein-building amino acid |
| − | + | ** a proteinogenic amino acid | |
| − | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-6601]] | ||
| + | * [[RXN66-336]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[3.4.11.4-RXN]] |
| + | * [[3.4.11.1-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]] |
== External links == | == External links == | ||
| − | + | {{#set: common name=a standard α amino acid}} | |
| − | + | {{#set: common name=a protein-building amino acid|a proteinogenic amino acid}} | |
| − | + | {{#set: consumed by=RXN-6601|RXN66-336}} | |
| − | + | {{#set: produced by=3.4.11.4-RXN|3.4.11.1-RXN}} | |
| − | + | {{#set: reversible reaction associated=ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN}} | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: produced by=RXN- | + | |
| − | {{#set: | + | |
Revision as of 22:19, 17 March 2018
Contents
Metabolite Amino-Acids-20
- common name:
- a standard α amino acid
- Synonym(s):
- a protein-building amino acid
- a proteinogenic amino acid
