Difference between revisions of "PWY-2002"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == * smiles: ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O * inchi k...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2002 PWY-2002] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-38...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2002 PWY-2002] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-3803] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** isoflavonoid biosynthesis I |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''5''' reactions in the full pathway | |
| − | * [[ | + | * [[RXN-3221]] |
| − | == Reaction(s) | + | ** 2 associated gene(s): |
| − | * [[RXN- | + | *** [[Ec-05_001880]] |
| + | *** [[Ec-00_005930]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-3283 RXN-3283] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-3284 RXN-3284] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-3481 RXN-3481] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-3501 RXN-3501] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-3803}} | |
| − | + | {{#set: common name=isoflavonoid biosynthesis I}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=5}} | |
| − | + | {{#set: completion rate=20.0}} | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 20:31, 21 March 2018
Pathway PWY-2002
- taxonomic range:
- common name:
- isoflavonoid biosynthesis I
- Synonym(s):
Reaction(s) found
1 reactions found over 5 reactions in the full pathway
- RXN-3221
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
